CAS 141801-46-9
:N-deuterio-N-(2,3,4,5,6-pentadeuteriophenyl)acetamide
Description:
N-deuterio-N-(2,3,4,5,6-pentadeuteriophenyl)acetamide is a deuterated compound, which means it contains deuterium, a stable isotope of hydrogen. This compound is characterized by its unique isotopic labeling, which is useful in various scientific applications, particularly in NMR spectroscopy and studies involving metabolic pathways. The presence of deuterium can enhance the sensitivity and resolution of spectroscopic techniques, allowing for more precise structural elucidation and dynamic studies of molecular interactions. The acetamide functional group indicates that the compound has both amine and carbonyl characteristics, contributing to its potential reactivity and solubility in polar solvents. The pentadeuteriophenyl moiety suggests that the compound has a phenyl ring with multiple deuterium substitutions, which can influence its physical properties, such as melting point and boiling point, compared to its non-deuterated counterparts. Overall, this compound serves as a valuable tool in research fields such as medicinal chemistry, biochemistry, and materials science, where isotopic labeling can provide insights into molecular behavior and interactions.
Formula:C8H3D6NO
InChI:InChI=1/C8H9NO/c1-7(10)9-8-5-3-2-4-6-8/h2-6H,1H3,(H,9,10)/i2D,3D,4D,5D,6D/hD
SMILES:CC(=Nc1c(c(c(c(c1[2H])[2H])[2H])[2H])[2H])O[2H]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Acetanilide-d6
CAS:Controlled Product<p>Applications N-D readily exchanges in protic solvents.<br>References Dong, X., et al.: Bioorg. Med. Chem., 16, 8151 (2008), Kotecha, J., et al.: Int. J. Pharm., 360, 96 (2008), Takenaka, S., et al.: J. Biosci. Bioeng., 107, 27 (2009),<br></p>Formula:C8D6H3NOColor and Shape:White To Off-WhiteMolecular weight:141.20Acetamide-N-d, N-(phenyl-d5)- (9CI)
CAS:Formula:C8H3D6NOColor and Shape:SolidMolecular weight:141.2001

