CymitQuimica logo

CAS 141811-44-1

:

(ethylsulfonyl)acetic acid

Description:
Ethylsulfonylacetic acid, with the CAS number 141811-44-1, is an organic compound characterized by the presence of both an ethylsulfonyl group and a carboxylic acid functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in polar solvents such as water and alcohols, which is indicative of its polar functional groups. Ethylsulfonylacetic acid may exhibit acidic properties due to the carboxylic acid moiety, allowing it to participate in various chemical reactions, including esterification and neutralization. Additionally, the sulfonyl group can enhance the compound's reactivity and influence its biological activity, making it of interest in pharmaceutical and agrochemical applications. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, ethylsulfonylacetic acid is a versatile compound with potential applications in various fields of chemistry.
Formula:C4H8O4S
InChI:InChI=1/C4H8O4S/c1-2-9(7,8)3-4(5)6/h2-3H2,1H3,(H,5,6)
InChI key:XTKCDFOXCDJUGE-UHFFFAOYSA-N
SMILES:CCS(=O)(=O)CC(=O)O
Synonyms:
  • Acetic Acid, 2-(Ethylsulfonyl)-
  • (Ethylsulfonyl)acetic acid
Found 3 products.