CAS 1418117-76-6: Methyl 4-methyl-2,5-dioxo-4-imidazolidinepropanoate
Description:Methyl 4-methyl-2,5-dioxo-4-imidazolidinepropanoate, with the CAS number 1418117-76-6, is a chemical compound that belongs to the class of imidazolidine derivatives. This substance features a five-membered ring structure containing nitrogen, which contributes to its unique chemical properties. The presence of dioxo groups indicates that it has two carbonyl functionalities, which can participate in various chemical reactions, including nucleophilic attacks and condensation reactions. The methyl ester functional group suggests that it can undergo hydrolysis to release the corresponding acid. This compound may exhibit biological activity, potentially serving as a precursor in the synthesis of pharmaceuticals or agrochemicals. Its solubility, stability, and reactivity can vary depending on the solvent and environmental conditions. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, Methyl 4-methyl-2,5-dioxo-4-imidazolidinepropanoate is of interest in both synthetic chemistry and potential applications in medicinal chemistry.
Formula:C8H12N2O4
InChI:InChI=1S/C8H12N2O4/c1-8(4-3-5(11)14-2)6(12)9-7(13)10-8/h3-4H2,1-2H3,(H2,9,10,12,13)
InChI key:InChIKey=OLWNVBMSDUOWKM-UHFFFAOYSA-N
SMILES:O=C1NC(=O)C(N1)(C)CCC(=O)OC
- Synonyms:
- 4-Imidazolidinepropanoic acid, 4-methyl-2,5-dioxo-, methyl ester
- Methyl 4-methyl-2,5-dioxo-4-imidazolidinepropanoate
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 4-Imidazolidinepropanoic acid, 4-methyl-2,5-dioxo-, methyl ester REF: IN-DA001H87CAS: 1418117-76-6 | - - - | To inquire | Mon 14 Apr 25 |
 | Methyl 3-(4-Methyl-2,5-dioxo-4-imidazolidinyl)propanoate REF: 54-OR470573CAS: 1418117-76-6 | - - - | To inquire | Mon 21 Apr 25 |
 | Methyl 3-(4-methyl-2,5-dioxoimidazolidin-4-yl)propanoate REF: 10-F769495CAS: 1418117-76-6 | 98% | - - - | Discontinued product |
 | Methyl 3-(4-methyl-2,5-dioxoimidazolidin-4-yl)propanoate REF: 3D-FM170084CAS: 1418117-76-6 | Min. 95% | - - - | Discontinued product |
4-Imidazolidinepropanoic acid, 4-methyl-2,5-dioxo-, methyl ester
Ref: IN-DA001H87
| Undefined size | To inquire |
Methyl 3-(4-Methyl-2,5-dioxo-4-imidazolidinyl)propanoate
Ref: 54-OR470573
| Undefined size | To inquire |
Methyl 3-(4-methyl-2,5-dioxoimidazolidin-4-yl)propanoate
Ref: 10-F769495
| 1g | Discontinued | Request information |
Methyl 3-(4-methyl-2,5-dioxoimidazolidin-4-yl)propanoate
Ref: 3D-FM170084
| 1g | Discontinued | Request information | |
| 50mg | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
