CAS 1418117-85-7

Ethyl 5-ethoxy-2-thiophenecarboxylate

Description:

Ethyl 5-ethoxy-2-thiophenecarboxylate is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic heterocycle containing sulfur. This compound features an ethyl ester functional group, contributing to its reactivity and solubility properties. The presence of the ethoxy group enhances its polarity, making it more soluble in polar solvents compared to non-polar solvents. Ethyl 5-ethoxy-2-thiophenecarboxylate is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its unique structure allows for potential applications in materials science, particularly in the development of conductive polymers or organic electronic devices. The compound's stability and reactivity can be influenced by various factors, including temperature and the presence of catalysts. As with many organic compounds, safety precautions should be observed when handling it, as it may pose health risks if ingested or inhaled. Overall, this compound exemplifies the diverse chemistry associated with thiophene derivatives.

Formula: C₉H₁₂O₃S

InChI: InChI=1S/C9H12O3S/c1-3-11-8-6-5-7(13-8)9(10)12-4-2/h5-6H,3-4H2,1-2H3

InChI key: InChIKey=VAOFPWCLCBNYPE-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1SC(OCC)=CC1

Synonyms:

• 2-Thiophenecarboxylic acid, 5-ethoxy-, ethyl ester
• Ethyl 5-ethoxy-2-thiophenecarboxylate

Ethyl 5-ethoxy-2-thiophenecarboxylate

CAS: 1418117-85-7

Formula: C₉H₁₂O₃S

Molecular weight: 200.2548

Ref: IN-DA001H7Y

Ethyl 5-Ethoxy-2-thiophenecarboxylate

CAS: 1418117-85-7

Ethyl 5-Ethoxy-2-thiophenecarboxylate

Purity: ≥95%

Molecular weight: 200.25g/mol

Ref: 54-OR470580