CAS 141887-34-5
:2-(propyl{[2'-(2H-tetrazol-5-yl)biphenyl-4-yl]methyl}amino)pyridine-3-carboxylic acid
Description:
The chemical substance known as 2-(propyl{[2'-(2H-tetrazol-5-yl)biphenyl-4-yl]methyl}amino)pyridine-3-carboxylic acid, with the CAS number 141887-34-5, is a complex organic compound characterized by its multi-functional structure. It features a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom, contributing to its basicity and potential for forming coordination complexes. The presence of a carboxylic acid group indicates acidic properties, allowing for proton donation in solution. Additionally, the compound contains a biphenyl moiety and a tetrazole ring, which may impart unique electronic and steric properties, enhancing its potential biological activity. The propyl group serves as an alkyl substituent, influencing the compound's solubility and lipophilicity. Overall, this compound's intricate structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its characteristics, including solubility, stability, and reactivity, would be influenced by the interplay of its functional groups and overall molecular architecture.
Formula:C23H22N6O2
InChI:InChI=1/C23H22N6O2/c1-2-14-29(22-20(23(30)31)8-5-13-24-22)15-16-9-11-17(12-10-16)18-6-3-4-7-19(18)21-25-27-28-26-21/h3-13H,2,14-15H2,1H3,(H,30,31)(H,25,26,27,28)
SMILES:CCCN(Cc1ccc(cc1)c1ccccc1c1n[nH]nn1)c1c(cccn1)C(=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-Pyridinecarboxylic acid, 2-[propyl[[2'-(2H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl]methyl]amino]-
CAS:Formula:C23H22N6O2Molecular weight:414.45982-(N-Propyl-N-((2'-(1H-tetrazol-5-yl)biphenyl-4-yl)methyl)amino)pyridine-3-carboxylic acid
CAS:2-(N-Propyl-N-((2'-(1H-tetrazol-5-yl)biphenyl-4-yl)methyl)amino)pyridine-3-carboxylic acid (DPCPX) is a potent, selective, and orally active nonpeptide α 1 -adrenergic receptor antagonist. DPCPX binds to the α 1 -adrenergic receptor in tissues such as blood vessels, heart, and kidneys. The binding of DPCPX to these receptors prevents the activation of the G protein that results in vasoconstriction and reduces blood pressure. It also blocks the activation of β 2 -adrenergic receptors that can lead to bronchospasm and heart arrhythmias. Pharmacokinetic studies have shown that DPCPX has a rapid onset of action with a short duration of activity due to its high lipid solubility.Formula:C23H22N6O2Purity:Min. 95%Molecular weight:414.5 g/molA81988
CAS:A81988 is an antagonist of angiotensin AT1 receptors.Formula:C23H22N6O2Purity:98%Color and Shape:SolidMolecular weight:414.46


