CAS 14189-82-3
:3-(Methylphenylamino)-2-propenal
Description:
3-(Methylphenylamino)-2-propenal, also known by its CAS number 14189-82-3, is an organic compound characterized by the presence of an amino group attached to a propenal structure. This compound features a methylphenyl group, which contributes to its aromatic properties, enhancing its stability and reactivity. The propenal moiety indicates that it contains an α,β-unsaturated aldehyde, making it susceptible to nucleophilic attack, which is a key feature in various chemical reactions, including Michael additions and condensation reactions. The presence of the amino group also suggests potential for hydrogen bonding and interaction with other polar molecules, which can influence its solubility and reactivity in different solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and organic synthesis. Its structural characteristics suggest potential applications in the development of pharmaceuticals or agrochemicals, although specific applications would depend on further research into its properties and reactivity.
Formula:C10H11NO
InChI:InChI=1S/C10H11NO/c1-11(8-5-9-12)10-6-3-2-4-7-10/h2-9H,1H3
InChI key:InChIKey=YLMOTKLYENPQLK-UHFFFAOYSA-N
SMILES:N(C=CC=O)(C)C1=CC=CC=C1
Synonyms:- 2-Propenal, 3-(methylphenylamino)-
- 3-(Methylphenylamino)-2-propenal
- 3-(Methylphenylamino)acrolein
- 3-(N-Methyl-N-phenylamino)acrolein
- 3-(N-Methylanilino)acrolein
- 3-(N-phenyl-N-methylamino)Acrolein
- 3-Amino-N-Methyl-N-Phenylacrolein
- 3-N-Methyl-N-Phenylaminoacrolein
- 3-N-Methyl-N-Phenylaminoacroleini
- Acrolein, 3-(N-methylanilino)-
- N-Methyl-N-phenyl-3-aminoacrolein
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Propenal, 3-(methylphenylamino)-
CAS:Formula:C10H11NOPurity:98%Color and Shape:SolidMolecular weight:161.20043-(N-Phenyl-N-methyl)aminoacrolein
CAS:3-(N-Phenyl-N-methyl)aminoacroleinPurity:98%Molecular weight:161.20g/mol3-(N-Phenyl-N-methyl)aminoacrolein
CAS:3-(N-Phenyl-N-methyl)aminoacrolein is a hydrophobic compound that has been shown to reversibly bind to serum albumin. This binding leads to a decrease in the lipid content of lipoproteins and a decrease in the rate of their metabolism. These effects are mediated by hydrophobic interactions with the hydrophobic regions of serum albumin. 3-(N-Phenyl-N-methyl)aminoacrolein also interacts with human serum albumin, which is involved in lipid transport and metabolism, and can be used as a contrast agent for X-ray diffraction studies.
Formula:C10H11NOPurity:Min. 97 Area-%Color and Shape:PowderMolecular weight:161.2 g/molRef: 3D-IP167308
Discontinued product



