CAS 141895-35-4

Boc-DL-Tyr(Me)-OH

Description:

Boc-DL-Tyr(Me)-OH, also known as Boc-DL-tyrosine methyl ester, is a derivative of the amino acid tyrosine, characterized by the presence of a tert-butyloxycarbonyl (Boc) protecting group and a methyl ester functional group. This compound is typically used in peptide synthesis and organic chemistry as a protected form of tyrosine, which allows for selective reactions without interfering with the amino or hydroxyl groups. The Boc group is a common protecting group that can be easily removed under mild acidic conditions, facilitating further chemical transformations. The methyl ester enhances the lipophilicity of the molecule, which can influence its solubility and reactivity. As a racemic mixture of D and L forms, Boc-DL-Tyr(Me)-OH can be utilized in various biochemical applications, including drug development and the synthesis of biologically active peptides. Its stability and reactivity make it a valuable intermediate in synthetic organic chemistry.

Formula: C₁₅H₂₁NO₅

InChI: InChI=1/C15H21NO5/c1-15(2,3)21-14(19)16-12(13(17)18)9-10-5-7-11(20-4)8-6-10/h5-8,12H,9H2,1-4H3,(H,16,19)(H,17,18)

SMILES: CC(C)(C)OC(=NC(Cc1ccc(cc1)OC)C(=O)O)O

Synonyms:

• N-(tert-butoxycarbonyl)-O-methyltyrosine

Boc-D,L-Tyr(Me)-OH

CAS: 141895-35-4

Formula: C₁₅H₂₁NO₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 295.3309

Ref: IN-DA001HCA

2-((tert-Butoxycarbonyl)amino)-3-(4-methoxyphenyl)propanoic acid

CAS: 141895-35-4

2-((tert-Butoxycarbonyl)amino)-3-(4-methoxyphenyl)propanoic acid

Purity: 98%

Molecular weight: 295.33g/mol

Ref: 54-OR90300

BOC-DL-TYR(ME)-OH

CAS: 141895-35-4

M03188 - BOC-DL-TYR(ME)-OH

Formula: C₁₅H₂₁NO₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 295.335

Ref: 10-M03188