CAS 14190-16-0: Tetramethylammonium sulfate

Description:Tetramethylammonium sulfate (TMA-SO4) is a quaternary ammonium salt characterized by its structure, which consists of a tetramethylammonium cation and a sulfate anion. It is typically a white crystalline solid that is soluble in water and polar organic solvents, making it useful in various applications, including as a phase transfer catalyst and in organic synthesis. TMA-SO4 exhibits properties typical of quaternary ammonium compounds, such as being a surfactant and having antimicrobial activity. Its ionic nature contributes to its ability to interact with both organic and inorganic substances, enhancing its utility in chemical processes. Additionally, it is relatively stable under standard conditions but should be handled with care due to potential toxicity associated with quaternary ammonium compounds. Overall, tetramethylammonium sulfate is valued in both industrial and laboratory settings for its unique properties and versatility in facilitating chemical reactions.

Formula:C₄H₁₂NO₄S

InChI:InChI=1S/C4H12N.H2O4S/c2*1-5(2,3)4/h1-4H3;(H2,1,2,3,4)/q+1;/p-2

InChI key:InChIKey=DWTYPCUOWWOADE-UHFFFAOYSA-L

SMILES:O=S(=O)([O-])[O-].C[N+](C)(C)C

Synonyms:
Ammonium, tetramethyl-, sulfate (2:1)
Bis(tetramethylammonium) sulfate
Methanaminium, N,N,N-trimethyl-, sulfate (2:1)
Tetramethylammonium sulfate
Tetramethylammonium sulfate (2:1)
bis(N,N,N-trimethylmethanaminium) sulfate
Tetramethylammonium sulphate (2:1)

Found 4 products.

Product data	Purity	Price range	Estimated delivery
Tetramethylammonium Sulfate REF: 3B-T1240CAS: 14190-16-0	>98.0%(T)	47.00 €~130.00 €	Wed 02 Apr 25
Methanaminium, N,N,N-trimethyl-, sulfate (2:1) REF: IN-DA001HCLCAS: 14190-16-0	98%	36.00 €~516.00 €	Wed 09 Apr 25
Tetramethylammonium sulfate REF: 54-OR72823CAS: 14190-16-0	98+%	32.00 €~2,447.00 €	Thu 10 Apr 25
Tetramethylammonium Sulfate REF: 3D-FT76037CAS: 14190-16-0	Min. 95%	- - -	Discontinued product