CAS 1419075-84-5: 4-Bromo-2-chloro-5-(trifluoromethoxy)benzoic acid

Description:4-Bromo-2-chloro-5-(trifluoromethoxy)benzoic acid is an aromatic carboxylic acid characterized by the presence of a benzoic acid core substituted with a bromine atom, a chlorine atom, and a trifluoromethoxy group. The molecular structure features a bromine atom at the para position, a chlorine atom at the ortho position, and a trifluoromethoxy group at the meta position relative to the carboxylic acid functional group. This compound is likely to exhibit significant polarity due to the electronegative halogen substituents and the carboxylic acid group, which can influence its solubility in various solvents. The trifluoromethoxy group contributes to its unique electronic properties, potentially enhancing its reactivity and interactions in chemical processes. Additionally, the presence of multiple halogens may impart biological activity, making it of interest in pharmaceutical and agrochemical research. Overall, this compound's distinct functional groups and structural features suggest potential applications in various fields, including medicinal chemistry and materials science.

Formula:C₈H₃BrClF₃O₃

InChI:InChI=1S/C8H3BrClF3O3/c9-4-2-5(10)3(7(14)15)1-6(4)16-8(11,12)13/h1-2H,(H,14,15)

InChI key:InChIKey=FXGHMQFEQHOELI-UHFFFAOYSA-N

SMILES:O=C(O)C=1C=C(OC(F)(F)F)C(Br)=CC1Cl