![2-amino-4-{[(1E)-hydrazinomethylidene]amino}butanoic acid](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F348343-2-amino-4-1e-hydrazinomethylidene-amino-butanoic-acid.webp&w=3840&q=75)
CAS 14191-90-3
:2-amino-4-{[(1E)-hydrazinomethylidene]amino}butanoic acid
Description:
2-amino-4-{[(1E)-hydrazinomethylidene]amino}butanoic acid, commonly known as a derivative of amino acids, features a complex structure that includes both amino and hydrazine functional groups. This compound is characterized by its dual amino functionalities, which contribute to its potential as a building block in peptide synthesis and other biochemical applications. The presence of the hydrazinomethylidene group suggests reactivity typical of hydrazines, which can participate in various chemical reactions, including condensation and redox processes. This compound is likely to exhibit polar characteristics due to the presence of multiple amine groups, influencing its solubility in water and other polar solvents. Additionally, its structure may allow for hydrogen bonding, impacting its interactions in biological systems. As with many amino acid derivatives, it may play a role in metabolic pathways or serve as a precursor for more complex biomolecules. Safety and handling considerations should be observed, as compounds with hydrazine moieties can be hazardous.
Formula:C5H12N4O2
InChI:InChI=1/C5H12N4O2/c6-4(5(10)11)1-2-8-3-9-7/h3-4H,1-2,6-7H2,(H,8,9)(H,10,11)
SMILES:C(CN=CNN)C(C(=O)O)N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
L-Norarginine Dihydrochloride
CAS:Controlled ProductFormula:C5H12N4O2·2(HCl)Color and Shape:NeatMolecular weight:233.09
