CAS 1419101-09-9

1,1-Dimethylethyl 4-(ethoxymethyl)-4-hydroxy-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 4-(ethoxymethyl)-4-hydroxy-1-piperidinecarboxylate, identified by its CAS number 1419101-09-9, is a chemical compound that features a piperidine ring, which is a six-membered saturated heterocyclic structure containing one nitrogen atom. This compound is characterized by the presence of a tert-butyl group (1,1-dimethylethyl) and an ethoxymethyl group, contributing to its unique structural and functional properties. The hydroxy group on the piperidine ring enhances its potential for hydrogen bonding, which can influence its solubility and reactivity. Additionally, the carboxylate functionality suggests that it may exhibit acidic properties, making it relevant in various chemical reactions. The compound's molecular structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological systems. Overall, its specific characteristics, including molecular weight, solubility, and reactivity, would be essential for understanding its behavior in different chemical environments and potential applications.

Formula: C₁₃H₂₅NO₄

InChI: InChI=1S/C13H25NO4/c1-5-17-10-13(16)6-8-14(9-7-13)11(15)18-12(2,3)4/h16H,5-10H2,1-4H3

InChI key: InChIKey=RXPJSQJGAHDOPU-UHFFFAOYSA-N

SMILES: C(OCC)C1(O)CCN(C(OC(C)(C)C)=O)CC1

Synonyms:

• 1,1-Dimethylethyl 4-(ethoxymethyl)-4-hydroxy-1-piperidinecarboxylate
• 1-Piperidinecarboxylic acid, 4-(ethoxymethyl)-4-hydroxy-, 1,1-dimethylethyl ester
• 1-Boc-4-(ethoxymethyl)piperidin-4-ol

tert-Butyl 4-(ethoxymethyl)-4-hydroxypiperidine-1-carboxylate

CAS: 1419101-09-9

Formula: C₁₃H₂₅NO₄

Color and Shape: Liquid

Molecular weight: 259.3419

Ref: IN-DA001HD2

1-BOC-4-(ETHOXYMETHYL)PIPERIDIN-4-OL

CAS: 1419101-09-9

Formula: C₁₃H₂₅NO₄

Purity: 95.0%

Molecular weight: 259.346

Ref: 10-F468282