CymitQuimica logo

CAS 1419101-54-4

:

1,1-Dimethylethyl 2-hydroxy-6-azaspiro[3.5]nonane-6-carboxylate

Description:
1,1-Dimethylethyl 2-hydroxy-6-azaspiro[3.5]nonane-6-carboxylate, identified by its CAS number 1419101-54-4, is a chemical compound characterized by its unique spirocyclic structure, which includes a nitrogen atom within a bicyclic framework. This compound features a tert-butyl group (1,1-dimethylethyl) that contributes to its steric bulk, enhancing its stability and potentially influencing its reactivity. The presence of a hydroxyl group (-OH) indicates that it can participate in hydrogen bonding, which may affect its solubility and interaction with other molecules. Additionally, the carboxylate functional group suggests that it can act as a weak acid, capable of donating protons in appropriate conditions. The azaspiro structure may impart interesting conformational properties, making it relevant in medicinal chemistry and drug design. Overall, this compound's unique structural features and functional groups suggest potential applications in various fields, including pharmaceuticals and organic synthesis, although specific reactivity and biological activity would require further investigation.
Formula:C13H23NO3
InChI:InChI=1S/C13H23NO3/c1-12(2,3)17-11(16)14-6-4-5-13(9-14)7-10(15)8-13/h10,15H,4-9H2,1-3H3
InChI key:InChIKey=KSJLUFYKVIPHSC-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CC2(CC(O)C2)CCC1
Synonyms:
  • tert-Butyl 2-hydroxy-6-azaspiro[3.5]nonane-6-carboxylate
  • 6-Azaspiro[3.5]nonane-6-carboxylic acid, 2-hydroxy-, 1,1-dimethylethyl ester
  • 1,1-Dimethylethyl 2-hydroxy-6-azaspiro[3.5]nonane-6-carboxylate
Found 5 products.