CAS 141912-71-2

Methyl imidazo[1,5-a]pyridine-5-carboxylate

Description:

Methyl imidazo[1,5-a]pyridine-5-carboxylate is a heterocyclic organic compound characterized by its imidazole and pyridine rings, which contribute to its unique chemical properties. This compound features a carboxylate functional group, enhancing its reactivity and solubility in polar solvents. It typically appears as a crystalline solid and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. The presence of the methyl ester group suggests it may undergo hydrolysis to yield the corresponding carboxylic acid, which can further participate in various chemical reactions. Its structure allows for potential interactions with biological targets, making it of interest in drug design and synthesis. Additionally, the compound's stability and reactivity can be influenced by factors such as pH and temperature, which are important considerations in both laboratory and industrial settings. Overall, Methyl imidazo[1,5-a]pyridine-5-carboxylate represents a versatile scaffold in organic synthesis and medicinal chemistry.

Formula: C₉H₈N₂O₂

InChI: InChI=1S/C9H8N2O2/c1-13-9(12)8-4-2-3-7-5-10-6-11(7)8/h2-6H,1H3

InChI key: InChIKey=KSVWOAUWLZIVRX-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1N2C(C=CC1)=CN=C2

Synonyms:

• Imidazo[1,5-a]pyridine-5-carboxylic acid, methyl ester
• Methyl imidazo[1,5-a]pyridine-5-carboxylate

Methyl imidazo[1,5-a]pyridine-5-carboxylate

CAS: 141912-71-2

Formula: C₉H₈N₂O₂

Molecular weight: 176.1720

Ref: IN-DA001HDU

Methyl imidazo[1,5-a]pyridine-5-carboxylate

CAS: 141912-71-2

Formula: C₉H₈N₂O₂

Purity: 95.0%

Molecular weight: 176.175

Ref: 10-F221107