CAS 1419140-82-1

3-Thiomorpholinecarboxylic acid, 2,2-dimethyl-, 1,1-dioxide, (3R)-

Description:

3-Thiomorpholinecarboxylic acid, 2,2-dimethyl-, 1,1-dioxide, (3R)-, with CAS number 1419140-82-1, is a chemical compound characterized by its unique structural features, including a thiomorpholine ring and a carboxylic acid functional group. The presence of the 1,1-dioxide indicates that it contains a sulfone group, which contributes to its chemical reactivity and potential biological activity. The (3R)- designation suggests that the compound has a specific stereochemistry, which can influence its interactions in biological systems. This compound may exhibit properties typical of thiomorpholines, such as potential antimicrobial or anti-inflammatory activities, making it of interest in pharmaceutical research. Additionally, the presence of the dimethyl groups can affect its solubility and stability. Overall, the characteristics of this compound make it a subject of interest for further studies in medicinal chemistry and related fields.

Formula: C₇H₁₃NO₄S

InChI: InChI=1S/C7H13NO4S/c1-7(2)5(6(9)10)8-3-4-13(7,11)12/h5,8H,3-4H2,1-2H3,(H,9,10)/t5-/m1/s1

InChI key: InChIKey=LXSUDKDWKJBDKG-RXMQYKEDSA-N

SMILES: CC1(C)[C@@H](C(O)=O)NCCS1(=O)=O

Synonyms:

• 3-Thiomorpholinecarboxylic acid, 2,2-dimethyl-, 1,1-dioxide, (3R)-