CAS 14192-67-7
:6-chloro-2,3,4,9-tetrahydro-1H-carbazol-1-one
Description:
6-Chloro-2,3,4,9-tetrahydro-1H-carbazol-1-one is a chemical compound characterized by its complex bicyclic structure, which includes a carbazole moiety. This compound features a chlorine substituent at the 6-position and a carbonyl group at the 1-position, contributing to its reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of the tetrahydro structure indicates that it has undergone partial hydrogenation, which can influence its chemical properties and interactions. This compound may be of interest in medicinal chemistry due to its structural similarity to various bioactive molecules, potentially exhibiting pharmacological properties. Its CAS number, 14192-67-7, allows for easy identification and reference in chemical databases. As with many organic compounds, safety data should be consulted to understand its handling, storage, and potential hazards in laboratory settings.
Formula:C12H10ClNO
InChI:InChI=1/C12H10ClNO/c13-7-4-5-10-9(6-7)8-2-1-3-11(15)12(8)14-10/h4-6,14H,1-3H2
SMILES:C1Cc2c3cc(ccc3[nH]c2C(=O)C1)Cl
Synonyms:- 1H-Carbazol-1-one, 6-chloro-2,3,4,9-tetrahydro-
- 6-Chloro-2,3,4,9-tetrahydro-carbazol-1-one
- Carbazol-1(2H)-one, 3,4-dihydro-6-chloro-
- 6-Chloro-2,3,4,9-tetrahydro-1H-carbazol-1-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1H-Carbazol-1-one, 6-chloro-2,3,4,9-tetrahydro-
CAS:Formula:C12H10ClNOPurity:95%Color and Shape:SolidMolecular weight:219.66696-Chloro-2,3,4,9-tetrahydro-1H-carbazol-1-one
CAS:6-Chloro-2,3,4,9-tetrahydro-1H-carbazol-1-onePurity:98%Molecular weight:219.67g/mol6-chloro-2,3,4,9-tetrahydro-1H-carbazol-1-one
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:219.66999816894536-chloro-2,3,4,9-tetrahydro-1H-carbazol-1-one
CAS:<p>6-Chloro-2,3,4,9-tetrahydro-1H-carbazol-1-one is a pyrrole with a planar conformation. It has hydrogen bonds to the carbonyl group and two benzenes. The molecule is centrosymmetric and has a dihedral angle of 180°. 6-Chloro-2,3,4,9-tetrahydro-1H-carbazol-1-one crystallizes in the orthorhombic system. The unit cell dimensions are a=8.05 Å b=8.05 Å c=7.04 Å α=β=γ=90°</p>Formula:C12H10ClNOPurity:Min. 95%Molecular weight:219.67 g/mol




