CAS 1419221-61-6

4-Bromo-3-fluoro-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide

Description:

4-Bromo-3-fluoro-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide is a chemical compound characterized by its complex structure, which includes a benzamide core substituted with bromine and fluorine atoms, as well as a pyridine ring with a trifluoromethyl group. This compound is typically classified as an aromatic amide, exhibiting properties such as moderate solubility in organic solvents and potential reactivity due to the presence of halogen substituents. The bromine and fluorine atoms contribute to its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The trifluoromethyl group is known to enhance metabolic stability and can affect the compound's interaction with biological targets. Overall, this compound's unique combination of functional groups suggests potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. Its specific characteristics, such as melting point, boiling point, and spectral data, would require experimental determination or reference to detailed chemical databases for precise values.

Formula: C₁₃H₇BrF₄N₂O

InChI: InChI=1S/C13H7BrF4N2O/c14-9-2-1-7(5-10(9)15)12(21)20-11-6-8(3-4-19-11)13(16,17)18/h1-6H,(H,19,20,21)

InChI key: InChIKey=NGTXOESDDQQSAU-UHFFFAOYSA-N

SMILES: N(C(=O)C1=CC(F)=C(Br)C=C1)C2=CC(C(F)(F)F)=CC=N2

Synonyms:

• 4-Bromo-3-fluoro-N-(4-(trifluoromethyl)pyridin-2-yl)benzamide
• Benzamide, 4-bromo-3-fluoro-N-[4-(trifluoromethyl)-2-pyridinyl]-
• 4-Bromo-3-fluoro-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide

4-BROMO-3-FLUORO-N-(4-(TRIFLUOROMETHYL)PYRIDIN-2-YL)BENZAMIDE

CAS: 1419221-61-6

Formula: C₁₃H₇BrF₄N₂O

Purity: 95.0%

Molecular weight: 363.11

Ref: 10-F528938