CAS 14193-18-1
:3,5-DINITROBENZALDEHYDE
Description:
3,5-Dinitrobenzaldehyde is an organic compound characterized by the presence of both aldehyde and nitro functional groups. It features a benzene ring substituted with two nitro groups at the 3 and 5 positions, and an aldehyde group at the 1 position. This compound typically appears as a yellow crystalline solid and is known for its strong electron-withdrawing nitro groups, which significantly influence its reactivity and properties. It is often used in organic synthesis, particularly in the preparation of various dyes and pharmaceuticals. The presence of the aldehyde group allows for further reactions, such as condensation and reduction, making it a versatile intermediate in chemical synthesis. Additionally, 3,5-dinitrobenzaldehyde exhibits notable solubility in organic solvents, while its stability can be affected by environmental conditions. Due to its nitro groups, it may also pose certain hazards, including toxicity and potential environmental impact, necessitating careful handling and disposal in laboratory settings.
Formula:C7H4N2O5
InChI:InChI=1/C7H4N2O5/c10-4-5-1-6(8(11)12)3-7(2-5)9(13)14/h1-4H
SMILES:c1c(cc(cc1N(=O)=O)N(=O)=O)C=O
Synonyms:- Benzaldehyde, 3,5-Dinitro-
- 3,5-DINITROBENZALDEHYDE
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Benzaldehyde, 3,5-dinitro-
CAS:Formula:C7H4N2O5Purity:98%Color and Shape:SolidMolecular weight:196.11713,5-Dinitrobenzaldehyde
CAS:<p>3,5-Dinitrobenzaldehyde is an experimental herbicide that has been shown to be effective in the control of weeds. 3,5-Dinitrobenzaldehyde is a protonated electrophilic species that reacts with a variety of electron-rich aromatic compounds by nucleophilic attack at the ortho position. The reaction with benzene, for example, yields phenyl trifluoride and benzenesulfonic acid. This molecule also reacts with chloride to form chlorobenzene and dinitrobenzene. 3,5-Dinitrobenzaldehyde has kinetic properties that are dependent on frequency and layeredness as well as kinetic and dihedral angles. It is also a catalytic reagent that undergoes rapid reaction at room temperature.</p>Formula:C7H4N2O5Purity:Min. 95%Molecular weight:196.12 g/mol




