CAS 141943-04-6

1-benzylpiperidine-3-carboxylic acid

Description:

1-Benzylpiperidine-3-carboxylic acid is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. The presence of a benzyl group at the first position and a carboxylic acid functional group at the third position contributes to its unique properties. This compound typically exhibits moderate solubility in polar solvents due to the carboxylic acid group, while the benzyl moiety may enhance lipophilicity. It is often studied in medicinal chemistry for its potential biological activities, including its role as a building block in the synthesis of various pharmaceuticals. The compound's structure allows for potential interactions with biological targets, making it of interest in drug development. Additionally, its stability and reactivity can be influenced by the pH of the environment, particularly due to the acidic nature of the carboxylic group. Overall, 1-benzylpiperidine-3-carboxylic acid is a versatile compound with applications in organic synthesis and medicinal chemistry.

Formula: C₁₃H₁₇NO₂

InChI: InChI=1/C13H17NO2/c15-13(16)12-7-4-8-14(10-12)9-11-5-2-1-3-6-11/h1-3,5-6,12H,4,7-10H2,(H,15,16)

SMILES: c1ccc(cc1)CN1CCCC(C1)C(=O)O

3-Piperidinecarboxylic acid, 1-(phenylmethyl)-

CAS: 141943-04-6

Formula: C₁₃H₁₇NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 219.2796

Ref: IN-DA001HFQ

1-Benzylpiperidine-3-carboxylic acid

CAS: 141943-04-6

1-Benzylpiperidine-3-carboxylic acid

Purity: 97%

Molecular weight: 219.28g/mol

Ref: 54-OR93991

1-Benzylpiperidine-3-carboxylic acid

CAS: 141943-04-6

Formula: C₁₃H₁₇NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 219.284

Ref: 10-F237842