CymitQuimica logo

CAS 141945-41-7

:

2-acetyl-3-hydroxy-6,7-dihydro-1H,5H-pyrido[3,2,1-ij]quinolin-1-one

Description:
2-acetyl-3-hydroxy-6,7-dihydro-1H,5H-pyrido[3,2,1-ij]quinolin-1-one is a heterocyclic compound characterized by its complex bicyclic structure, which incorporates both pyridine and quinoline moieties. This compound features an acetyl group and a hydroxyl group, contributing to its reactivity and potential biological activity. The presence of the hydroxyl group suggests that it may exhibit hydrogen bonding capabilities, influencing its solubility and interaction with other molecules. The dihydro configuration indicates that the compound may exist in a reduced form, which can affect its stability and reactivity. This substance may be of interest in medicinal chemistry due to its structural features, which could be linked to various pharmacological activities. Additionally, its unique structure may allow for specific interactions with biological targets, making it a candidate for further research in drug development or as a potential therapeutic agent. Overall, the compound's characteristics suggest a rich chemistry that warrants investigation for its potential applications in various fields.
Formula:C14H13NO3
InChI:InChI=1/C14H13NO3/c1-8(16)11-13(17)10-6-2-4-9-5-3-7-15(12(9)10)14(11)18/h2,4,6,18H,3,5,7H2,1H3
SMILES:CC(=O)c1c(=O)c2cccc3CCCn(c23)c1O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.