CAS 141946-05-6

1-THIEN-2-YL-1,4-DIHYDRO-5H-TETRAZOL-5-ONE

Description:

1-Thien-2-yl-1,4-dihydro-5H-tetrazol-5-one is a heterocyclic compound characterized by its unique structure, which includes a thienyl group and a tetrazolone moiety. The thienyl group, derived from thiophene, contributes to the compound's aromatic properties and potential reactivity. The tetrazolone part of the molecule features a five-membered ring containing four nitrogen atoms and one carbonyl group, which imparts significant chemical stability and potential for various chemical transformations. This compound is often studied for its biological activity, particularly in medicinal chemistry, due to the presence of both nitrogen and sulfur in its structure, which can influence pharmacological properties. Additionally, its ability to form hydrogen bonds and engage in π-π stacking interactions may enhance its interactions with biological targets. The compound's solubility, stability, and reactivity can vary depending on the specific conditions, making it a subject of interest in both synthetic and applied chemistry.

Formula: C₅H₄N₄OS

InChI: InChI=1/C5H4N4OS/c10-5-6-7-8-9(5)4-2-1-3-11-4/h1-3H,(H,6,8,10)

SMILES: c1cc(n2c(nnn2)O)sc1

Synonyms:

• 1-thiophen-2-yl-1,2-dihydro-5H-tetrazol-5-one
• 1-thien-2-yl-1,4-dihydro-5H-tetrazol-5-one

1-(Thiophen-2-yl)-4,5-dihydro-1H-1,2,3,4-tetrazol-5-one

CAS: 141946-05-6

Versatile small molecule scaffold

Formula: C₅H₄N₄OS

Purity: Min. 95%

Molecular weight: 168.18 g/mol

Ref: 3D-RFA94605