CAS 14198-59-5
:6',7',10,11-tetramethoxyemetan
Description:
6',7',10,11-tetramethoxyemetan, with the CAS number 14198-59-5, is a chemical compound characterized by the presence of four methoxy groups (-OCH3) attached to a core structure derived from emetan. This compound is typically classified within the broader category of organic compounds, specifically as a methoxy-substituted derivative. The presence of multiple methoxy groups can significantly influence its physical and chemical properties, such as solubility, reactivity, and potential biological activity. Generally, compounds with such substitutions may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The methoxy groups can enhance lipophilicity, potentially affecting the compound's ability to permeate biological membranes. Additionally, the structural configuration may lead to specific stereochemical properties, influencing how the compound interacts with biological targets. Overall, while detailed studies on this specific compound may be limited, its structural characteristics suggest potential applications in various fields, including pharmaceuticals and organic synthesis.
Formula:C29H41BrN2O4
InChI:InChI=1/C29H40N2O4.BrH/c1-6-18-17-31-10-8-20-14-27(33-3)29(35-5)16-23(20)25(31)12-21(18)11-24-22-15-28(34-4)26(32-2)13-19(22)7-9-30-24;/h13-16,18,21,24-25,30H,6-12,17H2,1-5H3;1H/t18-,21-,24-,25-;/m1./s1
SMILES:CC[C@@H]1CN2CCc3cc(c(cc3[C@H]2C[C@H]1C[C@@H]1c2cc(c(cc2CCN1)OC)OC)OC)OC.Br
Synonyms:- 2H-Benzo(a)quinolizine, 3-ethyl-1,3,4,6,7,11b-hexahydro-9,10-dimethoxy-2-((1,2,3,4-tetrahydro-6,7-dimethoxy-1-isoquinolyl)methyl)-
- 2H-benzo[a]quinolizine, 3-ethyl-1,3,4,6,7,11b-hexahydro-9,10-dimethoxy-2-[(1,2,3,4-tetrahydro-6,7-dimethoxy-1-isoquinolinyl)methyl]-
- 3-Ethyl-1,3,4,6,7,11b-hexahydro-9,10-dimethoxy-2-((1,2,3,4-tetrahydro-6,7-dimethoxy-1-isoquinolyl)methyl)-2H-benzo[a]quinolizine
- 2-[(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)methyl]-3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-pyrido[2,1-a]isoquinoline hydrobromide
- 6',7',10,11-Tetramethoxyemetan
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Emetine hydrochloride
CAS:<p>Alkaloid from the roots of the tropical plant Cephaelis ipecacuanha and active ingredient in ipecac. The compound is an inhibitor of protein synthesis and DNA replication. It prevents the formation of Okazaki fragments and uncouples leading and lagging strands during DNA replication. Ementine therefore selectively inhibits the lagging strand synthesis and prevents ADP-ribosylation in the S-phase of cell cycle. It can be used for the preparation and of newly synthesised DNA. The compound has been also used as antiprotozoal agent for the treatment of ameboasis.</p>Formula:C29H40N2O4·HClPurity:Min. 95%Molecular weight:517.1 g/molEmetine hydrochloride
CAS:This novel compound is an orally bioavailable antagonist of P2X3/P2X2/3 receptors, exhibiting potent activity with a pIC50 of 8 in both human and rat, and a pIC50 of 7.3 specifically for the human P2X2/3 receptor. It demonstrates high brain penetration, evidenced by a brain to plasma ratio of 6, and effectively blocks agonist-evoked intracellular Ca2+ flux and inward currents within the nanomolar range (10 nM to 1 µM) in cell lines that express human P2X3 and P2X2/3 receptors recombinantly. The compound also shows favorable pharmacokinetic properties, with a half-life (t1/2) of 1.63 hours and a time to reach maximum concentration (Tmax) of 30 minutes.Formula:C29H41ClN2O4Color and Shape:SolidMolecular weight:517.1




