CAS 141992-47-4
:1,4-dimethoxyacridine-9(10H)-thione
Description:
1,4-Dimethoxyacridine-9(10H)-thione is a chemical compound characterized by its acridine backbone, which is a polycyclic aromatic structure known for its fluorescent properties. The presence of two methoxy groups at the 1 and 4 positions enhances its solubility and can influence its electronic properties, making it potentially useful in various applications, including organic electronics and photochemistry. The thione functional group at the 9(10H) position introduces a sulfur atom, which can participate in various chemical reactions, including nucleophilic attacks and coordination with metals. This compound may exhibit interesting biological activities, as many acridine derivatives are known for their antimicrobial and antitumor properties. Its molecular structure suggests potential for interactions with biological macromolecules, which could be explored in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by the substituents on the acridine ring, making it a subject of interest in synthetic organic chemistry and materials science.
Formula:C15H13NO2S
InChI:InChI=1/C15H13NO2S/c1-17-11-7-8-12(18-2)14-13(11)15(19)9-5-3-4-6-10(9)16-14/h3-8H,1-2H3,(H,16,19)
SMILES:COc1ccc(c2c1c(=S)c1ccccc1[nH]2)OC
Synonyms:- 9(10H)-Acridinethione, 1,4-dimethoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Cdk4 Inhibitor II, NSC 625987
CAS:<p>Cdk4 Inhibitor II, NSC 625987 is a small molecule that inhibits the activity of Cyclin-Dependent Kinase 4 (Cdk4) in vitro and in vivo. Cdk4 inhibitor II has been shown to inhibit cell proliferation in vitro and to have anti-tumor effects in vivo. Cdk4 inhibitor II can be used for the treatment of cancer, including breast cancer. This drug has inhibitory properties on transcriptional regulation and growth factor signaling pathways, which induces neuronal death by inhibiting the phosphorylation of extracellular signal regulated kinase 1/2. Cdk4 inhibitor II is also known to induce apoptosis through caspase activation, as well as inhibiting angiogenesis and inducing cellular senescence.</p>Formula:C15H13NO2SPurity:Min. 95%Molecular weight:271.33 g/molNSC 625987
CAS:Cyclin-dependent kinase (cdk) 4 inhibitorFormula:C15H13NO2SPurity:98%Color and Shape:SolidMolecular weight:271.33



