CymitQuimica logo

CAS 141998-22-3

:

N,N′-[1,2-Ethanediylbis(imino-2,1-ethanediyl)]bis[acetamide]

Description:
N,N′-[1,2-Ethanediylbis(imino-2,1-ethanediyl)]bis[acetamide], with the CAS number 141998-22-3, is a synthetic organic compound characterized by its complex structure featuring multiple functional groups. This compound contains two acetamide moieties linked by an ethanediyl bridge, which contributes to its unique chemical properties. The presence of imino groups indicates potential for coordination with metal ions, making it of interest in coordination chemistry and catalysis. The compound is likely to exhibit solubility in polar solvents due to the presence of amide functionalities, which can engage in hydrogen bonding. Its structural features may also impart specific reactivity patterns, particularly in nucleophilic or electrophilic reactions. Additionally, the compound's potential applications could extend to fields such as materials science, pharmaceuticals, or as a ligand in metal complexation. However, detailed studies would be necessary to fully elucidate its physical and chemical properties, including stability, reactivity, and potential biological activity.
Formula:C10H22N4O2
InChI:InChI=1S/C10H22N4O2/c1-9(15)13-7-5-11-3-4-12-6-8-14-10(2)16/h11-12H,3-8H2,1-2H3,(H,13,15)(H,14,16)
InChI key:InChIKey=WJZSOPBEHMQITR-UHFFFAOYSA-N
SMILES:C(NC(C)=O)CNCCNCCNC(C)=O
Synonyms:
  • N,N′-[1,2-Ethanediylbis(imino-2,1-ethanediyl)]bis[acetamide]
  • Acetamide, N,N′-[1,2-ethanediylbis(imino-2,1-ethanediyl)]bis-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.