CymitQuimica logo

CAS 141998-90-5

:

3-iodo-1-phenyl-1H-pyrazole

Description:
3-Iodo-1-phenyl-1H-pyrazole is an organic compound characterized by its pyrazole ring, which is a five-membered ring containing two nitrogen atoms. The presence of an iodine atom at the 3-position and a phenyl group at the 1-position contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents and may be less soluble in water due to its hydrophobic phenyl group. It is often used in medicinal chemistry and research due to its potential biological activity, including anti-inflammatory and anticancer properties. The iodo substituent can also enhance reactivity in various chemical reactions, such as nucleophilic substitutions or coupling reactions. As with many halogenated compounds, safety precautions should be taken when handling 3-iodo-1-phenyl-1H-pyrazole, as iodine can be hazardous. Overall, this compound serves as an important building block in the synthesis of more complex molecules in pharmaceutical and agrochemical research.
Formula:C10H9IN2
InChI:InChI=1/C10H9IN2/c11-10-6-12-13(8-10)7-9-4-2-1-3-5-9/h1-6,8H,7H2
InChI key:RJCCRXXUBFGPBW-UHFFFAOYSA-N
SMILES:c1ccc(cc1)Cn1cc(cn1)I
Found 4 products.