CAS 1420-06-0
:Trifenmorph
Description:
Trifenmorph, with the CAS number 1420-06-0, is a chemical compound primarily used as a fungicide in agricultural applications. It belongs to the morpholine class of compounds and is characterized by its ability to inhibit the growth of various fungal pathogens, making it effective in protecting crops. Trifenmorph is typically applied to a range of crops, including fruits and vegetables, to prevent fungal diseases. The compound exhibits a relatively low toxicity profile for humans and animals when used according to recommended guidelines, although it is essential to follow safety precautions during handling and application. Its mode of action involves disrupting the synthesis of ergosterol, a critical component of fungal cell membranes, thereby impairing fungal growth and reproduction. Additionally, Trifenmorph is known for its systemic properties, allowing it to be absorbed and translocated within plants, providing extended protection against fungal infections. As with many agrochemicals, environmental considerations regarding its use, persistence, and potential impact on non-target organisms are important factors in its application and regulation.
Formula:C23H23NO
InChI:InChI=1S/C23H23NO/c1-4-10-20(11-5-1)23(21-12-6-2-7-13-21,22-14-8-3-9-15-22)24-16-18-25-19-17-24/h1-15H,16-19H2
InChI key:InChIKey=ZJMLMBICUVVJDX-UHFFFAOYSA-N
SMILES:C(C1=CC=CC=C1)(C2=CC=CC=C2)(C3=CC=CC=C3)N4CCOCC4
Synonyms:- 4-(Triphenylmethyl)morpholine
- 4-Tritylmorpholine
- Frescon
- Morpholine, 4-(triphenylmethyl)-
- Morpholine, 4-trityl-
- N-Tritylmorpholine
- Shell WL 8008
- Triphenmorphe
- Wl 8008
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
