CAS 14202-14-3

3,5-DIMETHYLADAMANTANE-1-ACIDIC ACID

Description:

3,5-Dimethyladamantane-1-acetic acid, identified by its CAS number 14202-14-3, is a chemical compound that belongs to the class of adamantane derivatives. This compound features a unique adamantane core structure, which is a polycyclic hydrocarbon known for its stability and rigidity. The presence of two methyl groups at the 3 and 5 positions of the adamantane framework contributes to its steric properties and influences its reactivity. The carboxylic acid functional group (-COOH) at the 1-position imparts acidic characteristics, allowing it to participate in various chemical reactions, such as esterification and amidation. This compound may exhibit interesting biological activities due to its structural features, making it a subject of interest in medicinal chemistry. Additionally, its solubility and stability in different solvents can vary, which is important for its application in research and potential pharmaceutical development. Overall, 3,5-dimethyladamantane-1-acetic acid represents a fascinating example of how structural modifications can affect the properties and reactivity of organic compounds.

Formula: C₁₄H₂₂O₂

InChI: InChI=1/C14H22O2/c1-12-3-10-4-13(2,7-12)9-14(5-10,8-12)6-11(15)16/h10H,3-9H2,1-2H3,(H,15,16)

SMILES: CC12CC3CC(C)(C1)CC(C3)(CC(=O)O)C2

Synonyms:

• Tricyclo[3.3.1.1~3,7~]Decane-1-Acetic Acid, 3,5-Dimethyl-
• (3,5-Dimethyltricyclo[3.3.1.1~3,7~]Dec-1-Yl)Acetic Acid

3,5-Dimethyl-1-adamantaneacetic acid, 97%

CAS: 14202-14-3

A commonly used as an organic reagent and pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU re

Formula: C₁₄H₂₂O₂

Purity: 97%

Molecular weight: 222.32

Ref: 02-H66357

3,5-Dimethyl-1-adamantaneacetic acid

CAS: 14202-14-3

Formula: C₁₄H₂₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 222.3233

Ref: IN-DA001HKS

3,5-Dimethyladamantane-1-acetic acid

CAS: 14202-14-3

3,5-Dimethyladamantane-1-acetic acid

Purity: 97%

Molecular weight: 222.32g/mol

Ref: 54-OR309171