CAS 1420291-58-2

4-[(1E)-2-(3,5-Dihydroxyphenyl)ethenyl]phenyl-2,3,5,6-d₄ β-<span class="text-smallcaps">D</span>-glucopyranosiduronic acid

Description:

The chemical substance known as "4-[(1E)-2-(3,5-Dihydroxyphenyl)ethenyl]phenyl-2,3,5,6-d₄ β-D-glucopyranosiduronic acid" with CAS number 1420291-58-2 is a complex organic compound characterized by its structural features, which include a glucopyranosiduronic acid moiety and a phenyl group substituted with a vinyl and dihydroxyphenyl group. This compound is likely to exhibit properties typical of phenolic compounds, such as antioxidant activity, due to the presence of hydroxyl groups. The deuterated nature of the compound (indicated by "d₄") suggests that it has been modified for specific applications, possibly in research involving isotopic labeling or tracing. Its solubility, stability, and reactivity would depend on the functional groups present and the overall molecular structure. Additionally, the presence of the glucuronic acid component may confer biological relevance, as glucuronides are often involved in metabolic processes and detoxification pathways in living organisms. Overall, this compound represents a unique intersection of organic chemistry and potential biological activity.

Formula: C₂₀H₂₀O₉

InChI: InChI=1S/C20H20O9/c21-12-7-11(8-13(22)9-12)2-1-10-3-5-14(6-4-10)28-20-17(25)15(23)16(24)18(29-20)19(26)27/h1-9,15-18,20-25H,(H,26,27)/b2-1+/t15-,16-,17+,18-,20+/m0/s1/i3D,4D,5D,6D

InChI key: InChIKey=CDEBVTGYVFHDMA-IBVOQACESA-N

SMILES: O([C@@H]1O[C@H](C(O)=O)[C@@H](O)[C@H](O)[C@H]1O)C2=C(C(=C(/C=C/C3=CC(O)=CC(O)=C3)C(=C2[2H])[2H])[2H])[2H]

Synonyms:

• 4-[(1E)-2-(3,5-Dihydroxyphenyl)ethenyl]phenyl-2,3,5,6-d4 β-D-glucopyranosiduronic acid
• β-D-Glucopyranosiduronic acid, 4-[(1E)-2-(3,5-dihydroxyphenyl)ethenyl]phenyl-2,3,5,6-d4
• Resveratrol-d4 4'-Glucuronide

Resveratrol-d4 4'-Glucuronide

CAS: 1420291-58-2

Formula: C₂₀H₁₆D₄O₉

Color and Shape: Pale Brown Solid

Molecular weight: 408.40

Ref: 4Z-R-079024