CAS 142038-30-0
:N-(2-amino-3,8-dimethyl-3H-imidazo[4,5-f]quinoxalin-5-yl)-2'-deoxyguanosine
Description:
N-(2-amino-3,8-dimethyl-3H-imidazo[4,5-f]quinoxalin-5-yl)-2'-deoxyguanosine is a modified nucleoside that features a guanosine backbone with an attached imidazoquinoxaline moiety. This compound is characterized by its unique structural features, which include a fused ring system that contributes to its biological activity. The presence of the amino group and the dimethyl substitutions on the imidazoquinoxaline structure may influence its interaction with nucleic acids and proteins, potentially affecting its role in cellular processes. This compound is of interest in the field of medicinal chemistry and molecular biology, particularly for its potential implications in cancer research and the study of mutagenesis, as the imidazoquinoxaline structure is known to be involved in DNA damage and repair mechanisms. Its solubility, stability, and reactivity can vary based on environmental conditions, making it a subject of investigation for therapeutic applications and the development of novel nucleoside analogs.
Formula:C21H22N10O4
InChI:InChI=1/C21H22N10O4/c1-8-5-23-14-9(3-10-15(16(14)25-8)27-20(22)30(10)2)26-21-28-18-17(19(34)29-21)24-7-31(18)13-4-11(33)12(6-32)35-13/h3,5,7,11-13,32-33H,4,6H2,1-2H3,(H2,22,27)(H2,26,28,29,34)/t11-,12+,13+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
N-(2-Amino-3,8-dimethylimidazo[4,5-f]quinoxalin-5-yl) 2'-deoxyguanosine
CAS:<p>N-(2-Amino-3,8-dimethylimidazo[4,5-f]quinoxalin-5-yl) 2'-deoxyguanosine (NADG) is a monophosphate nucleoside analog that inhibits the human immunodeficiency virus (HIV). NADG inhibits HIV by binding to the viral enzyme reverse transcriptase and inhibiting its activity. NADG also has anticancer activity through inhibition of DNA synthesis and protein synthesis. This compound is a novel nucleoside analog that has not been previously described in the literature.</p>Formula:C21H22N10O4Purity:Min. 95%Molecular weight:478.46 g/mol

