CAS 14204-97-8
:5-Nitro-6-methylaminoquinoline
Description:
5-Nitro-6-methylaminoquinoline is a chemical compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing a nitrogen atom. This compound features a nitro group (-NO2) at the 5-position and a methylamino group (-NH(CH3)) at the 6-position of the quinoline ring, contributing to its unique reactivity and properties. It is typically a yellow to orange crystalline solid, exhibiting moderate solubility in organic solvents. The presence of the nitro group can impart significant electrophilic characteristics, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the methylamino group can influence the compound's basicity and potential interactions with biological systems. 5-Nitro-6-methylaminoquinoline may be of interest in medicinal chemistry, particularly for its potential applications in drug development or as a fluorescent probe. However, safety and handling precautions should be observed due to the presence of the nitro group, which can pose hazards.
Formula:C10H9N3O2
InChI:InChI=1/C10H9N3O2/c1-11-9-5-4-8-7(3-2-6-12-8)10(9)13(14)15/h2-6,11H,1H3
SMILES:CNc1ccc2c(cccn2)c1N(=O)=O
Synonyms:- 6-(Methylamino)-5-nitroquinoline
- N-Methyl-5-nitro-6-quinolinamine
- Nsc 639644
- N-methyl-5-nitroquinolin-6-amine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
6-Quinolinamine, N-methyl-5-nitro-
CAS:Formula:C10H9N3O2Purity:95%Color and Shape:SolidMolecular weight:203.1974N-Methyl-5-nitroquinolin-6-amine
CAS:N-Methyl-5-nitroquinolin-6-aminePurity:98%Molecular weight:203.2g/mol5-Nitro-6-methylaminoquinoline-d3
CAS:Controlled ProductApplications 5-Nitro-6-methylaminoquinoline-d3 is an isotope labelled intermediate in the synthesis of carcinogen IQ and related 3H-imidazo[4,5-f]quinolines.
References Ronne, E., et al.: Acta. Chem. Scandinavica., 48, 823 (1994);Formula:C10D3H6N3O2Color and Shape:NeatMolecular weight:206.225-Nitro-6-methylaminoquinoline
CAS:Controlled ProductApplications 5-Nitro-6-methylaminoquinoline (cas# 14204-97-8) is a compound useful in organic synthesis.
Formula:C10H9N3O2Color and Shape:Dark YellowMolecular weight:203.2


