CAS 14206-74-7
:6-chloro-4-oxyimino-1-phenyl-1,2,3,4-tetrahydroquinoline
Description:
6-Chloro-4-oxyimino-1-phenyl-1,2,3,4-tetrahydroquinoline is a chemical compound characterized by its complex structure, which includes a tetrahydroquinoline core, a chloro substituent, and an oxyimino functional group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity, which may include antimicrobial or antitumor effects, making it of interest in pharmaceutical research. The presence of the chloro group can influence its reactivity and solubility, while the oxyimino group may enhance its interaction with biological targets. The compound's molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions or cycloadditions. Additionally, its stability and solubility in different solvents can vary, impacting its application in synthesis or as a drug candidate. Overall, 6-chloro-4-oxyimino-1-phenyl-1,2,3,4-tetrahydroquinoline represents a unique scaffold for further exploration in medicinal chemistry and related fields.
Formula:C15H13ClN2O
InChI:InChI=1/C15H13ClN2O/c16-11-6-7-15-13(10-11)14(17-19)8-9-18(15)12-4-2-1-3-5-12/h1-7,10,19H,8-9H2/b17-14-
Synonyms:- (4Z)-6-chloro-1-phenyl-2,3-dihydroquinolin-4(1H)-one oxime
- 4-Quinolinone, 1,2,3,4-tetrahydro-6-chloro-1-phenyl-, oxime
- M-7074
- BRN 1541369
- 4(1H)-Quinolinone, 6-chloro-2,3-dihydro-1-phenyl, oxime
- 4(1H)-Quinolone, 6-chloro-2,3-dihydro-1-phenyl-, oxime (8CI)
- 5-21-08-00064 (Beilstein Handbook Reference)
- 4(1H)-Quinolinone, 2,3-dihydro-6-chloro-1-phenyl-, oxime
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
6-Chloro-4-oxyimino-1-phenyl-1,2,3,4-tetrahydroquinoline
CAS:<p>6-Chloro-4-oxyimino-1-phenyl-1,2,3,4-tetrahydroquinoline is a bioactive chemical.</p>Formula:C15H13ClN2OColor and Shape:SolidMolecular weight:272.73
