CAS 1420792-16-0

6-Bromo-2-(5-isoquinolinyl)-4-quinolinecarboxylic acid

Description:

6-Bromo-2-(5-isoquinolinyl)-4-quinolinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a bromine atom and a quinoline moiety. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the isoquinoline ring enhances its potential for biological activity, making it of interest in medicinal chemistry. The bromine substituent can influence the compound's reactivity and solubility, potentially affecting its pharmacokinetic properties. Additionally, the compound may exhibit specific interactions with biological targets, which could be explored for therapeutic applications. Its molecular structure suggests that it may participate in various chemical reactions, including electrophilic substitutions and coupling reactions. Overall, 6-Bromo-2-(5-isoquinolinyl)-4-quinolinecarboxylic acid is a compound of interest for further research, particularly in the fields of drug development and organic synthesis, due to its unique structural features and potential biological implications.

Formula: C₁₉H₁₁BrN₂O₂

InChI: InChI=1S/C19H11BrN2O2/c20-12-4-5-17-15(8-12)16(19(23)24)9-18(22-17)14-3-1-2-11-10-21-7-6-13(11)14/h1-10H,(H,23,24)

InChI key: InChIKey=GSFZGYBQZXSYSS-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC(C=2C3=C(C=CC2)C=NC=C3)=NC4=C1C=C(Br)C=C4

Synonyms:

• 6-Bromo-2-(5-isoquinolinyl)-4-quinolinecarboxylic acid
• 4-Quinolinecarboxylic acid, 6-bromo-2-(5-isoquinolinyl)-