CymitQuimica logo

CAS 1421-04-1

:

DL-2,4-Diaminoglutaric acid

Description:
DL-2,4-Diaminoglutaric acid, with the CAS number 1421-04-1, is an organic compound that serves as a derivative of glutamic acid. It is characterized by the presence of two amino groups (-NH2) and a dicarboxylic acid structure, which contributes to its biochemical reactivity and potential applications in various fields, including biochemistry and pharmaceuticals. This compound is typically a white crystalline solid, soluble in water, and exhibits basic properties due to the amino groups. DL-2,4-Diaminoglutaric acid is involved in metabolic pathways, particularly in amino acid metabolism and the urea cycle. Its structural features allow it to participate in various enzymatic reactions, making it of interest in research related to amino acid synthesis and metabolism. Additionally, it may have implications in studies of neurobiology and cellular signaling due to its role as a precursor in the synthesis of other biologically relevant molecules. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C5H10N2O4
InChI:InChI=1/C5H10N2O4/c6-2(4(8)9)1-3(7)5(10)11/h2-3H,1,6-7H2,(H,8,9)(H,10,11)
Synonyms:
  • 4-aminoglutamic acid
  • DL-2,4-Diaminoglutaric acid
  • 2,4-bis(azanyl)pentanedioic acid
  • 2,4-diaminopentanedioic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.