CAS 1421-49-4: 3,5-Di-tert-butyl-4-hydroxybenzoic acid
Description:3,5-Di-tert-butyl-4-hydroxybenzoic acid, commonly referred to as DTBHB, is an organic compound characterized by its phenolic structure, which includes two bulky tert-butyl groups at the 3 and 5 positions and a hydroxyl group at the 4 position of the benzene ring. This compound is known for its antioxidant properties, making it useful in various applications, particularly in the stabilization of polymers and plastics against oxidative degradation. It exhibits good thermal stability and solubility in organic solvents, while being less soluble in water due to its hydrophobic tert-butyl groups. The presence of the hydroxyl group contributes to its ability to scavenge free radicals, enhancing its effectiveness as an antioxidant. Additionally, DTBHB is recognized for its low toxicity and is often employed in food packaging and other materials where oxidative stability is crucial. Its chemical stability and functional properties make it a valuable additive in industrial applications.
Formula:C15H22O3
InChI:InChI=1S/C15H22O3/c1-14(2,3)10-7-9(13(17)18)8-11(12(10)16)15(4,5)6/h7-8,16H,1-6H3,(H,17,18)
InChI key:InChIKey=YEXOWHQZWLCHHD-UHFFFAOYSA-N
SMILES:O=C(O)C=1C=C(C(O)=C(C1)C(C)(C)C)C(C)(C)C
- Synonyms:
- 2,6-Di-tert-butyl-4-carboxyphenol
- 3,5-Bis(1,1-dimethylethyl)-4-hydroxybenzoic acid
- 3,5-Bis-tert-butyl-4-hydroxybenzoic acid
- 3,5-Di-Tert-Butyl-4-Hydroxybenzoate
- 3,5-Ditert-butyl-4-hydroxybenzoic acid
- 4-Carboxy-2,6-di-tert-butylphenol
- 4-Hydroxy-3,5-di-tert-butylbenzoic acid
- Benzoic acid, 3,5-bis(1,1-dimethylethyl)-4-hydroxy-
- Benzoic acid, 3,5-di-tert-butyl-4-hydroxy-
- Dibutylhydroxybenzoicacid
- See more synonyms
- F 2 (antioxidant)
- Nickel(2+) Bis(3,5-Di-Tert-Butyl-4-Hydroxybenzoate)
- Potassium 3,5-Di-Tert-Butyl-4-Hydroxybenzoate
- 3,5-Di-tert-butyl-4-hydroxybenzoic acid
