CAS 142147-98-6

[2-[1-[[(1R)-1-[3-[2-(7-chloro-2-quinolyl)ethyl]phenyl]-3-[2-(1-hydroxy-1-methyl-ethyl)phenyl]propyl]sulfanylmethyl]cyclopropyl]acetyl]oxysodium

Description:

The chemical substance with the name "[2-[1-[[(1R)-1-[3-[2-(7-chloro-2-quinolyl)ethyl]phenyl]-3-[2-(1-hydroxy-1-methyl-ethyl)phenyl]propyl]sulfanylmethyl]cyclopropyl]acetyl]oxysodium" and CAS number "142147-98-6" is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as a cyclopropyl ring, a sulfonyl group, and various aromatic systems. This compound is likely to exhibit specific pharmacological properties, given its structural features that suggest potential interactions with biological targets. The presence of a chloroquinoline moiety may indicate activity against certain pathogens or cancer cells, while the hydroxyl and ethyl groups could influence solubility and bioavailability. As a sodium salt, it may also exhibit enhanced stability and solubility in aqueous environments. Overall, the compound's unique architecture suggests it could be of interest in medicinal chemistry, particularly in the development of therapeutic agents. However, detailed studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₃₅H₃₇ClNNaO₃S

InChI: InChI=1/C35H38ClNO3S.Na/c1-34(2,40)30-9-4-3-7-25(30)13-17-32(41-23-35(18-19-35)22-33(38)39)27-8-5-6-24(20-27)10-15-29-16-12-26-11-14-28(36)21-31(26)37-29;/h3-9,11-12,14,16,20-21,32,40H,10,13,15,17-19,22-23H2,1-2H3,(H,38,39);/q;+1/p-1/t32-;/m1./s1

SMILES: CC(C)(c1ccccc1CCC(c1cccc(CCc2ccc3ccc(cc3n2)Cl)c1)SCC1(CC1)CC(=O)O)O.[Na]

Dihydro Montelukast Sodium Salt

CAS: 142147-98-6

Formula: C₃₅H₃₇ClNNaO₃S

Purity: 95%

Color and Shape: Solid

Molecular weight: 610.1809

Ref: IN-DA001HUO

Dihydro Montelukast Sodium

CAS: 142147-98-6

Stability Hygroscopic
Applications A Montelukast impurity. A saturated hydroxyalkylquinoline acid as leukotriene antagonist and biosynthesis inhibitor.
References Hendeles. L., et al.: J. Alergy Clin. Immunol., 85, 197 (1990), Manning, P.J., et al.: N. Engl. J. Med., 323, 1736 (1990),

Formula: C₃₅H₃₈ClNO₃S·Na

Color and Shape: Neat

Molecular weight: 610.18

Ref: TR-D449215

Montelukast Dihydro Impurity

CAS: 142147-98-6

Formula: C₃₅H₃₈ClNO₃SNa

Molecular weight: 588.2 : 23.0

Ref: ST-EA-CP-M25047