CAS 1421602-09-6

Pyrrolidine, 2-(2-cyclopentylethyl)-, hydrochloride (1:1)

Description:

Pyrrolidine, 2-(2-cyclopentylethyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered saturated nitrogen-containing heterocycle. The presence of the cyclopentylethyl group contributes to its unique properties, potentially influencing its solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceutical formulations. The compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of drugs targeting the central nervous system or other therapeutic areas. Its molecular interactions, such as hydrogen bonding and hydrophobic effects, are essential for understanding its behavior in biological systems. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Further studies would be necessary to elucidate its specific pharmacological effects and mechanisms of action.

Formula: C₁₁H₂₁N·ClH

InChI: InChI=1S/C11H21N.ClH/c1-2-5-10(4-1)7-8-11-6-3-9-12-11;/h10-12H,1-9H2;1H

InChI key: InChIKey=ABQGEUOIGGYXJU-UHFFFAOYSA-N

SMILES: C(CC1CCCN1)C2CCCC2.Cl

Synonyms:

• Pyrrolidine, 2-(2-cyclopentylethyl)-, hydrochloride (1:1)

2-(2-Cyclopentylethyl)pyrrolidine hydrochloride

CAS: 1421602-09-6

Versatile small molecule scaffold

Formula: C₁₁H₂₂ClN

Purity: Min. 95%

Molecular weight: 203.75 g/mol

Ref: 3D-WGC60209