CAS 1421602-82-5

1H-Pyrazole-1-ethanamine, 4-nitro-, hydrochloride (1:1)

Description:

1H-Pyrazole-1-ethanamine, 4-nitro-, hydrochloride (1:1) is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two nitrogen atoms. The presence of an ethanamine group indicates that it has an amino functional group attached to an ethyl chain, contributing to its basicity and potential reactivity. The 4-nitro substituent on the pyrazole ring introduces a nitro group, which is known for its electron-withdrawing properties, influencing the compound's reactivity and stability. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals and research. The compound may exhibit biological activity, making it of interest in medicinal chemistry. Its CAS number, 1421602-82-5, allows for precise identification in chemical databases. Overall, this compound's unique structural features and functional groups suggest potential applications in drug development and other chemical research areas.

Formula: C₅H₈N₄O₂·ClH

InChI: InChI=1S/C5H8N4O2.ClH/c6-1-2-8-4-5(3-7-8)9(10)11;/h3-4H,1-2,6H2;1H

InChI key: InChIKey=BUVNXDJFXYSHCE-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=CN(CCN)N=C1.Cl

Synonyms:

• 1H-Pyrazole-1-ethanamine, 4-nitro-, hydrochloride (1:1)
• 2-(4-Nitro-1H-pyrazol-1-yl)ethan-1-amine hydrochloride

2-(4-Nitro-1H-pyrazol-1-yl)ethan-1-amine hydrochloride

CAS: 1421602-82-5

Versatile small molecule scaffold

Formula: C₅H₉ClN₄O₂

Purity: Min. 95%

Molecular weight: 192.6 g/mol

Ref: 3D-WGC60282