CAS 142172-51-8
:2-(4-BROMOBUTYL)-1 3 2-BENZODIOXABOROLE&
Description:
2-(4-Bromobutyl)-1,3,2-benzodioxaborole, with the CAS number 142172-51-8, is a chemical compound that features a benzodioxaborole structure, which is characterized by a dioxaborole ring fused to a benzene moiety. This compound contains a bromobutyl substituent, which contributes to its reactivity and potential applications in organic synthesis. The presence of the bromine atom enhances its electrophilic character, making it useful in various coupling reactions. The dioxaborole framework is known for its ability to form stable complexes with various nucleophiles, which can be advantageous in catalysis and material science. Additionally, compounds of this type may exhibit interesting biological activities, making them candidates for pharmaceutical research. Overall, the unique structural features of 2-(4-bromobutyl)-1,3,2-benzodioxaborole suggest its utility in both synthetic and medicinal chemistry contexts.
Formula:C10H12BBrO2
InChI:InChI=1/C10H12BBrO2/c12-8-4-3-7-11-13-9-5-1-2-6-10(9)14-11/h1-2,5-6H,3-4,7-8H2
SMILES:c1ccc2c(c1)OB(CCCCBr)O2
Synonyms:- 4-Bromo-1-butylboronic acid catechol ester, 96%
- 2-(4-Bromobutyl)-1,3,2-Benzodioxaborole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-(4-Bromobutyl)-1,3,2-benzodioxaborole
CAS:2-(4-Bromobutyl)-1,3,2-benzodioxaborole
Color and Shape:SolidMolecular weight:254.92g/mol

