CAS 1421933-33-6

14-Oxo-4,7,10-trioxa-13-thiapentadecanoic acid

Description:

14-Oxo-4,7,10-trioxa-13-thiapentadecanoic acid is a chemical compound characterized by its unique structure, which includes a long carbon chain, multiple oxygen atoms, and a sulfur atom. This compound features a carboxylic acid functional group, indicating it can participate in acid-base reactions and form salts or esters. The presence of the oxo group suggests it may exhibit ketone-like reactivity, while the trioxa indicates the inclusion of ether linkages within its structure. The thiol group contributes to its potential reactivity and interaction with other chemical species. This compound may exhibit properties such as solubility in polar solvents due to the presence of oxygen atoms, and it could have applications in various fields, including pharmaceuticals, materials science, or as a biochemical probe. Its specific reactivity and applications would depend on the context of its use and the presence of other functional groups in related compounds. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₁H₂₀O₆S

InChI: InChI=1S/C11H20O6S/c1-10(12)18-9-8-17-7-6-16-5-4-15-3-2-11(13)14/h2-9H2,1H3,(H,13,14)

InChI key: InChIKey=HJNQYRKIZPTUQT-UHFFFAOYSA-N

SMILES: C(CC(O)=O)OCCOCCOCCSC(C)=O

Synonyms:

• 4,7,10-Trioxa-13-thiapentadecanoic acid, 14-oxo-
• 14-Oxo-4,7,10-trioxa-13-thiapentadecanoic acid
• S-Acetyl-PEG3-acid

S-Acetyl-peg3-acid

CAS: 1421933-33-6

Formula: C₁₁H₂₀O₆S

Purity: 95%

Molecular weight: 280.3379

Ref: IN-DA00HWDQ

S-acetyl-PEG3-acid

CAS: 1421933-33-6

S-acetyl-PEG3-acid

Purity: 95%

Molecular weight: 280.34g/mol

Ref: 54-BIPG1757

S-Acetyl-PEG3-C2-acid

CAS: 1421933-33-6

S-Acetyl-PEG3-C2-acid is a PEG-based linker for PROTACs which joins two essential ligands, crucial for forming PROTAC molecules.

Formula: C₁₁H₂₀O₆S

Purity: 98%

Color and Shape: Solid

Molecular weight: 280.34

Ref: TM-T16822

S-Acetyl-PEG3-acid

CAS: 1421933-33-6

S-Acetyl-PEG3-acid is a PEG compound with two different functional groups (also known as heterobifunctional). Unlike homobifunctional PEG compounds (same functional group on both ends), this type of compounds are more versatile as have two different anchor points. S-Acetyl-PEG3-acid is used as a linker and spacer to add a PEG moiety, via pegylation (a bioconjugation technique) to proteins, peptides, oligonucleotides, small molecules and nanoparticles.

Formula: C₁₁H₂₀O₆S

Purity: Min. 95%

Molecular weight: 280.34 g/mol

Ref: 3D-WGC93333