CymitQuimica logo

CAS 1421933-35-8

:

2-(3-Oxetanyloxy)-5-pyrimidinol

Description:
2-(3-Oxetanyloxy)-5-pyrimidinol is a chemical compound characterized by its unique structural features, which include a pyrimidine ring and an oxetane moiety. The presence of the pyrimidinol group suggests that it possesses both basic and acidic properties, allowing it to participate in various chemical reactions, including hydrogen bonding and nucleophilic attacks. The oxetane ring contributes to the compound's potential reactivity, as it can undergo ring-opening reactions under certain conditions. This compound may exhibit interesting biological activities due to its structural components, making it a candidate for pharmaceutical applications. Additionally, its solubility and stability in different solvents can vary, influencing its behavior in chemical reactions and biological systems. Overall, 2-(3-Oxetanyloxy)-5-pyrimidinol represents a versatile structure with potential implications in medicinal chemistry and material science, warranting further investigation into its properties and applications.
Formula:C7H8N2O3
InChI:InChI=1S/C7H8N2O3/c10-5-1-8-7(9-2-5)12-6-3-11-4-6/h1-2,6,10H,3-4H2
InChI key:InChIKey=VMAKPVWDLNURJQ-UHFFFAOYSA-N
SMILES:O(C=1N=CC(O)=CN1)C2COC2
Synonyms:
  • 5-Pyrimidinol, 2-(3-oxetanyloxy)-
  • 2-(3-Oxetanyloxy)-5-pyrimidinol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.