CymitQuimica logo

CAS 1421933-39-2

:

1,1-Dimethylethyl 16-bromo-15-oxo-5,8,11-trioxa-2,14-diazahexadecanoate

Description:
1,1-Dimethylethyl 16-bromo-15-oxo-5,8,11-trioxa-2,14-diazahexadecanoate, identified by its CAS number 1421933-39-2, is a complex organic compound featuring a long carbon chain with multiple functional groups. This substance contains a bromo substituent, indicating the presence of bromine, which can influence its reactivity and potential applications in synthesis or as a reagent. The presence of oxo (carbonyl) and diaza (two nitrogen atoms) groups suggests that it may exhibit unique chemical properties, such as potential coordination with metal ions or participation in various chemical reactions. The three oxo groups contribute to its polarity, which can affect solubility in different solvents. Additionally, the branched structure indicated by the "1,1-dimethylethyl" group may enhance steric hindrance, influencing its interaction with other molecules. Overall, this compound's characteristics suggest it may have applications in medicinal chemistry, materials science, or as an intermediate in organic synthesis, although specific applications would depend on further research and analysis.
Formula:C15H29BrN2O6
InChI:InChI=1S/C15H29BrN2O6/c1-15(2,3)24-14(20)18-5-7-22-9-11-23-10-8-21-6-4-17-13(19)12-16/h4-12H2,1-3H3,(H,17,19)(H,18,20)
InChI key:InChIKey=LJDJJTQGFJMIKR-UHFFFAOYSA-N
SMILES:N(CCOCCOCCOCCNC(CBr)=O)C(OC(C)(C)C)=O
Synonyms:
  • 5,8,11-Trioxa-2,14-diazahexadecanoic acid, 16-bromo-15-oxo-, 1,1-dimethylethyl ester
  • 1,1-Dimethylethyl 16-bromo-15-oxo-5,8,11-trioxa-2,14-diazahexadecanoate
Found 6 products.