CAS 1421933-39-2
:1,1-Dimethylethyl 16-bromo-15-oxo-5,8,11-trioxa-2,14-diazahexadecanoate
Description:
1,1-Dimethylethyl 16-bromo-15-oxo-5,8,11-trioxa-2,14-diazahexadecanoate, identified by its CAS number 1421933-39-2, is a complex organic compound featuring a long carbon chain with multiple functional groups. This substance contains a bromo substituent, indicating the presence of bromine, which can influence its reactivity and potential applications in synthesis or as a reagent. The presence of oxo (carbonyl) and diaza (two nitrogen atoms) groups suggests that it may exhibit unique chemical properties, such as potential coordination with metal ions or participation in various chemical reactions. The three oxo groups contribute to its polarity, which can affect solubility in different solvents. Additionally, the branched structure indicated by the "1,1-dimethylethyl" group may enhance steric hindrance, influencing its interaction with other molecules. Overall, this compound's characteristics suggest it may have applications in medicinal chemistry, materials science, or as an intermediate in organic synthesis, although specific applications would depend on further research and analysis.
Formula:C15H29BrN2O6
InChI:InChI=1S/C15H29BrN2O6/c1-15(2,3)24-14(20)18-5-7-22-9-11-23-10-8-21-6-4-17-13(19)12-16/h4-12H2,1-3H3,(H,17,19)(H,18,20)
InChI key:InChIKey=LJDJJTQGFJMIKR-UHFFFAOYSA-N
SMILES:N(CCOCCOCCOCCNC(CBr)=O)C(OC(C)(C)C)=O
Synonyms:- 5,8,11-Trioxa-2,14-diazahexadecanoic acid, 16-bromo-15-oxo-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl 16-bromo-15-oxo-5,8,11-trioxa-2,14-diazahexadecanoate
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Bromoacetamido-PEG3 -Boc-amine
CAS:Bromoacetamido-PEG3 -Boc-amineFormula:C15H29BrN2O6Purity:95%Molecular weight:413.30455Bromoacetamido-PEG3-NH-Boc
CAS:Bromoacetamido-PEG3-NH-Boc is a polyethylene glycol (PEG)-based linker compound employed in the synthesis of proteolysis-targeting chimeras (PROTACs)[1].Formula:C15H29BrN2O6Color and Shape:SolidMolecular weight:413.3tert-Butyl (1-bromo-2-oxo-6,9,12-trioxa-3-azatetradecan-14-yl)carbamate
CAS:Formula:C15H29BrN2O6Purity:95%Color and Shape:LiquidMolecular weight:413.3046Bromoacetamido-PEG3-NH-Boc
CAS:tert-Butyl (1-bromo-2-oxo-6,9,12-trioxa-3-azatetradecan-14-yl)carbamateFormula:C15H29BrN2O6Purity:95%Molecular weight:413.3tert-Butyl (1-bromo-2-oxo-6,9,12-trioxa-3-azatetradecan-14-yl)carbamate
CAS:Purity:98%Molecular weight:413.3089905Bromoacetamido-PEG3-Boc-amine
CAS:Bromoacetamido-PEG3-Boc-amine is a PEG compound with two different functional groups (also known as heterobifunctional). Unlike homobifunctional PEG compounds (same functional group on both ends), this type of compounds are more versatile as have two different anchor points. Bromoacetamido-PEG3-Boc-amine is used as a linker and spacer to add a PEG moiety, via pegylation (a bioconjugation technique) to proteins, peptides, oligonucleotides, small molecules and nanoparticles.Formula:C15H29BrN2O6Purity:Min. 95%Molecular weight:413.3 g/mol





