CAS 142234-85-3: 3,3'-(7,12-diethyl-3,8,13,17,22-pentamethylporphyrin-2,18-diyl)dipropanoic acid
Description:3,3'-(7,12-diethyl-3,8,13,17,22-pentamethylporphyrin-2,18-diyl)dipropanoic acid, identified by its CAS number 142234-85-3, is a synthetic porphyrin derivative characterized by its complex structure, which includes a porphyrin core with multiple ethyl and methyl substituents. This compound features two propanoic acid functional groups, which contribute to its solubility and reactivity. Porphyrins are known for their ability to coordinate with metal ions, making them significant in various applications, including catalysis, photodynamic therapy, and as dyes. The presence of multiple alkyl groups enhances its lipophilicity, potentially influencing its biological interactions and stability. Additionally, the unique arrangement of substituents can affect the electronic properties of the molecule, impacting its absorption and emission spectra. Overall, this compound exemplifies the intricate relationship between molecular structure and function in porphyrin chemistry, with potential implications in fields such as materials science and biochemistry.
Formula:C35H40N4O4
InChI:InChI=1/C35H40N4O4/c1-8-22-18(3)26-14-27-19(4)24(10-12-34(40)41)29(36-27)15-30-25(11-13-35(42)43)20(5)28(38-30)16-33-23(9-2)21(6)32(39(33)7)17-31(22)37-26/h14-17,37H,8-13H2,1-7H3,(H,40,41)(H,42,43)/b26-14-,27-14-,28-16-,29-15-,30-15-,31-17-,32-17-,33-16-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | N-methyl Mesoporphyrin IX REF: TM-T37218CAS: 142234-85-3 | - - - | To inquire | Wed 30 Apr 25 |
![]() | N-Methyl Mesoporphyrin IX REF: FT-NMM580CAS: 142234-85-3 | >95% | To inquire | Fri 02 May 25 |
![]() | N-Methyl mesoporphyrin IX REF: 3D-FM160646CAS: 142234-85-3 | Min. 95% | 303.00 €~1,806.00 € | Mon 12 May 25 |

N-methyl Mesoporphyrin IX
Ref: TM-T37218
Undefined size | To inquire |

Ref: FT-NMM580
5mg | To inquire | ||
10mg | To inquire | ||
25mg | To inquire |

N-Methyl mesoporphyrin IX
Ref: 3D-FM160646
1mg | 303.00 € | ||
2mg | 455.00 € | ||
5mg | 719.00 € | ||
10mg | 1,054.00 € | ||
25mg | 1,806.00 € |