CAS 142234-85-3

3,3'-(7,12-diethyl-3,8,13,17,22-pentamethylporphyrin-2,18-diyl)dipropanoic acid

Description:

3,3'-(7,12-diethyl-3,8,13,17,22-pentamethylporphyrin-2,18-diyl)dipropanoic acid, identified by its CAS number 142234-85-3, is a synthetic porphyrin derivative characterized by its complex structure, which includes a porphyrin core with multiple ethyl and methyl substituents. This compound features two propanoic acid functional groups, which contribute to its solubility and reactivity. Porphyrins are known for their ability to coordinate with metal ions, making them significant in various applications, including catalysis, photodynamic therapy, and as dyes. The presence of multiple alkyl groups enhances its lipophilicity, potentially influencing its biological interactions and stability. Additionally, the unique arrangement of substituents can affect the electronic properties of the molecule, impacting its absorption and emission spectra. Overall, this compound exemplifies the intricate relationship between molecular structure and function in porphyrin chemistry, with potential implications in fields such as materials science and biochemistry.

Formula: C₃₅H₄₀N₄O₄

InChI: InChI=1/C35H40N4O4/c1-8-22-18(3)26-14-27-19(4)24(10-12-34(40)41)29(36-27)15-30-25(11-13-35(42)43)20(5)28(38-30)16-33-23(9-2)21(6)32(39(33)7)17-31(22)37-26/h14-17,37H,8-13H2,1-7H3,(H,40,41)(H,42,43)/b26-14-,27-14-,28-16-,29-15-,30-15-,31-17-,32-17-,33-16-

SMILES: CCc1c(C)c2=CC3=NC(=CC4=NC(=Cc5c(CC)c(C)c(C=c1[nH]2)n5C)C(=C4CCC(=O)O)C)C(=C3C)CCC(=O)O

N-Methylmesoporphyrin IX

CAS: 142234-85-3

N-Methylmesoporphyrin IX

Purity: ≥95%

Molecular weight: 580.72g/mol

Ref: 54-OR1035346

N-Methyl Mesoporphyrin IX

CAS: 142234-85-3

Formula: C₃₅H₄₀N₄O₄

Purity: >95%

Molecular weight: 580.72

Ref: FT-NMM580

N-Methyl mesoporphyrin IX

CAS: 142234-85-3

N-Methyl mesoporphyrin IX is a molecule that inhibits the activity of enzymes such as carboxylesterases, proteases, and aminopeptidases. It binds to the active site of these enzymes and blocks the enzyme's activity. N-Methyl mesoporphyrin IX has been shown to inhibit cancer cells in humans and can be used as an adjunct treatment for cancer. This drug also has anti-inflammatory properties due to its ability to inhibit prostaglandins synthesis. N-Methyl mesoporphyrin IX has been shown to have an effect on plant physiology by inhibiting plant growth and photosynthesis. N-Methyl mesoporphyrin IX is also able to enhance hybridization reactions between dsDNA duplexes, which may be useful in research involving DNA sequencing or gene mapping.

Formula: C₃₅H₄₀N₄O₄

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 580.72 g/mol

Ref: 3D-FM160646

N-methyl Mesoporphyrin IX

CAS: 142234-85-3

N-methyl Mesoporphyrin IX is a widely used G-quadruplex DNA-specific fluorescent binder that effectively monitors Aβ fibrillation. N-methyl Mesoporphyrin IX is sensitive to G-quadruplex DNA and unreactive to duplex, triplex, and single-stranded forms of DNA. N-methyl Mesoporphyrin IX needs to stack with Aβ assemblies to emit strong fluorescence. Meanwhile N-methyl Mesoporphyrin IX is an in situ inhibitor and ex situ monitor of Aβ amyloid production in vitro and intracellularly.

Formula: C₃₅H₄₀N₄O₄

Color and Shape: Solid

Molecular weight: 580.72

Ref: TM-T37218