
CAS 1422344-48-6: 1H-Imidazole-2-methanamine, α-methyl-, hydrochloride (1:1)
Description:1H-Imidazole-2-methanamine, α-methyl-, hydrochloride (1:1) is a chemical compound characterized by its imidazole ring structure, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This compound features an α-methyl group attached to the methanamine moiety, enhancing its basicity and potential reactivity. As a hydrochloride salt, it is typically encountered in a crystalline form, which improves its solubility in water and facilitates its use in various applications, including pharmaceuticals and biochemistry. The presence of the hydrochloride indicates that the compound is protonated, which can influence its interaction with biological systems. Its properties may include moderate to high melting points, depending on purity and specific conditions. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of drugs targeting neurological or metabolic pathways, owing to the imidazole's role in biological systems. As with many nitrogen-containing heterocycles, it may exhibit interesting pharmacological activities, making it a subject of interest in research and development.
Formula:C5H9N3·ClH
InChI:InChI=1S/C5H9N3.ClH/c1-4(6)5-7-2-3-8-5;/h2-4H,6H2,1H3,(H,7,8);1H
InChI key:InChIKey=YQKSNVGIELRMPI-UHFFFAOYSA-N
SMILES:Cl.N=1C=CNC1C(N)C
- Synonyms:
- 1H-Imidazole-2-methanamine, α-methyl-, hydrochloride (1:1)
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1-(1H-IMIDAZOL-2-YL)-ETHYLAMINE HYDROCHLRIDE REF: 10-F469485CAS: 1422344-48-6 | 95.0% | To inquire | Thu 03 Apr 25 |
![]() | 1-(1H-Imidazol-2-yl)ethan-1-amine hydrochloride REF: 3D-XGC34448CAS: 1422344-48-6 | Min. 95% | - - - | Discontinued product |

1-(1H-IMIDAZOL-2-YL)-ETHYLAMINE HYDROCHLRIDE
Ref: 10-F469485
250mg | To inquire |

1-(1H-Imidazol-2-yl)ethan-1-amine hydrochloride
Ref: 3D-XGC34448
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
25mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |