CAS 1422359-85-0: Fumonisin B3
Description:Fumonisin B3 is a mycotoxin produced by certain species of fungi, particularly Fusarium species, which are commonly found on corn and other cereal grains. It is part of the fumonisin family, which includes several related compounds known for their potential health risks. Fumonisin B3 is characterized by its structural features, including a long carbon chain and multiple functional groups, which contribute to its biological activity. This compound is primarily recognized for its ability to disrupt sphingolipid metabolism, leading to various toxicological effects, including hepatotoxicity and nephrotoxicity in animals. It has been studied for its potential role in human health issues, particularly in relation to certain cancers and neural tube defects. Fumonisin B3 is typically analyzed in food and feed products to assess contamination levels, as regulatory agencies monitor mycotoxin levels to ensure food safety. Its presence in agricultural products raises concerns about food safety and public health, necessitating ongoing research into its effects and mitigation strategies.
Formula:C34H59NO14
InChI:InChI=1S/C34H59NO14/c1-5-6-11-21(3)32(49-31(43)19-24(34(46)47)17-29(40)41)27(48-30(42)18-23(33(44)45)16-28(38)39)15-20(2)14-25(36)12-9-7-8-10-13-26(37)22(4)35/h20-27,32,36-37H,5-19,35H2,1-4H3,(H,38,39)(H,40,41)(H,44,45)(H,46,47)/t20-,21+,22-,23+,24+,25+,26-,27-,32+/m0/s1
InChI key:InChIKey=CPCRJSQNWHCGOP-STOIETHLSA-N
SMILES:O=C(O)CC(C(=O)O)CC(=O)OC(CC(C)CC(O)CCCCCCC(O)C(N)C)C(OC(=O)CC(C(=O)O)CC(=O)O)C(C)CCCC
- Synonyms:
- 1,2,3-Propanetricarboxylic acid, 1,1′-[(1S,2R)-1-[(2S,4R,11S,12S)-12-amino-4,11-dihydroxy-2-methyltridecyl]-2-[(1R)-1-methylpentyl]-1,2-ethanediyl] ester, (2R,2′R)-
- Fumonisin B3
- FB3
