CAS 1422506-50-0

Rauvotetraphylline B

Description:

Rauvotetraphylline B is a chemical compound that belongs to the class of alkaloids, which are naturally occurring organic compounds that mostly contain basic nitrogen atoms. This substance is derived from certain plant species and is noted for its potential biological activities, including antimicrobial and anti-inflammatory properties. The molecular structure of Rauvotetraphylline B features a complex arrangement of carbon, hydrogen, nitrogen, and oxygen atoms, contributing to its unique chemical behavior and interactions. Its specific stereochemistry may influence its biological activity and efficacy in various applications. As with many alkaloids, Rauvotetraphylline B may exhibit a range of pharmacological effects, making it a subject of interest in medicinal chemistry and drug development. However, detailed studies on its toxicity, pharmacokinetics, and therapeutic potential are essential for understanding its full implications in health and medicine. Further research is necessary to explore its mechanisms of action and potential uses in various therapeutic contexts.

Formula: C₃₁H₃₇N₃O₆

InChI: InChI=1S/C31H37N3O6/c1-4-16-18-11-23-26-19(17-7-5-6-8-20(17)33-26)12-22(25(18)21-10-14(2)9-15(3)32-21)34(23)30(16)40-31-29(38)28(37)27(36)24(13-35)39-31/h4-10,18,22-25,27-31,33,35-38H,11-13H2,1-3H3/b16-4+/t18-,22-,23-,24+,25-,27+,28-,29+,30?,31-/m0/s1

InChI key: InChIKey=UCCMUMCXKRGZPN-KBOKWPDZSA-N

SMILES: O([C@@H]\1[N@]2[C@@]3([C@@H]([C@@](C[C@]2(C4=C(C3)C=5C(N4)=CC=CC5)[H])(/C1=C\C)[H])C6=CC(C)=CC(C)=N6)[H])[C@@H]7O[C@H](CO)[C@@H](O)[C@H](O)[C@H]7O

Synonyms:

• Rauvotetraphylline B
• PubChem ID: 131636920

Rauvotetraphylline B

CAS: 1422506-50-0

Rauvotetraphylline B is a natural product from Rauvolfia tetraphylla.

Formula: C₃₁H₃₇N₃O₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 547.652

Ref: TM-TN4896

Rauvotetraphylline B

CAS: 1422506-50-0

Formula: C₃₁H₃₇N₃O₆

Purity: 95%~99%

Molecular weight: 547.652

Ref: BP-SBP02437

Rauvotetraphylline B

CAS: 1422506-50-0

Rauvotetraphylline B is an alkaloid compound, which is a naturally occurring chemical that is often derived from plant sources. It is specifically extracted from plants in the genus Rauvolfia, known for containing various bioactive alkaloids. The mode of action of Rauvotetraphylline B involves interactions with cellular pathways, potentially inhibiting the growth of cancer cells and affecting microbial cell wall synthesis.

Formula: C₃₁H₃₇N₃O₆

Purity: Min. 95%

Molecular weight: 547.6 g/mol

Ref: 3D-XGC50650