
CAS 142294-58-4
:2-Thiophenesulfonamide, 3-ethyl-
Description:
2-Thiophenesulfonamide, 3-ethyl- is an organic compound characterized by the presence of a thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. The sulfonamide functional group, characterized by the presence of a sulfonyl group (–SO2–) attached to an amine, contributes to its chemical reactivity and potential biological activity. The ethyl group at the 3-position of the thiophene ring introduces hydrophobic characteristics, influencing its solubility and interaction with biological systems. This compound may exhibit properties such as antimicrobial or anti-inflammatory activity, typical of many sulfonamides. Its molecular structure allows for various applications in pharmaceuticals and agrochemicals. Additionally, the presence of both the thiophene and sulfonamide functionalities may enhance its ability to interact with specific biological targets, making it of interest in medicinal chemistry. As with many chemical substances, safety data and handling precautions should be considered, particularly regarding its potential toxicity and environmental impact.
Formula:C6H9NO2S2
InChI:InChI=1S/C6H9NO2S2/c1-2-5-3-4-10-6(5)11(7,8)9/h3-4H,2H2,1H3,(H2,7,8,9)
InChI key:InChIKey=PNEQIBCAAUVHNU-UHFFFAOYSA-N
SMILES:S(N)(=O)(=O)C1=C(CC)C=CS1
Synonyms:- 2-Thiophenesulfonamide, 3-ethyl-
- 3-Ethylthiophene-2-sulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.