CAS 1422954-12-8: (2Z,5S,6E)-7-[4-(4-Fluorophenyl)-6-(1-methylethyl)-2-[methyl(methylsulfonyl)amino]-5-pyrimidinyl]-5-hydroxy-2,6-heptadienoic acid

Description:The chemical substance known as (2Z,5S,6E)-7-[4-(4-Fluorophenyl)-6-(1-methylethyl)-2-[methyl(methylsulfonyl)amino]-5-pyrimidinyl]-5-hydroxy-2,6-heptadienoic acid, with the CAS number 1422954-12-8, is a complex organic compound characterized by its specific stereochemistry and functional groups. It features a heptadienoic acid backbone, which includes multiple double bonds, contributing to its reactivity and potential biological activity. The presence of a pyrimidine ring indicates potential interactions with biological targets, particularly in medicinal chemistry. The fluorophenyl and isopropyl substituents enhance its lipophilicity, which may influence its pharmacokinetic properties. Additionally, the methylsulfonyl group suggests possible applications in drug design, as it can enhance solubility and metabolic stability. Overall, this compound's unique structure may confer specific biological activities, making it of interest in pharmaceutical research, particularly in the development of therapeutics targeting various diseases. Further studies would be necessary to elucidate its full biological profile and potential applications.

Formula:C₂₂H₂₆FN₃O₅S

InChI:InChI=1S/C22H26FN3O5S/c1-14(2)20-18(13-12-17(27)6-5-7-19(28)29)21(15-8-10-16(23)11-9-15)25-22(24-20)26(3)32(4,30)31/h5,7-14,17,27H,6H2,1-4H3,(H,28,29)/b7-5-,13-12+/t17-/m0/s1

InChI key:InChIKey=NZWJKTHFNLHUJO-IWEPXCJDSA-N

SMILES:O=C(O)C=CCC(O)C=CC=1C(=NC(=NC1C(C)C)N(C)S(=O)(=O)C)C=2C=CC(F)=CC2

Synonyms:
(2Z,5S,6E)-7-[4-(4-Fluorophenyl)-6-(1-methylethyl)-2-[methyl(methylsulfonyl)amino]-5-pyrimidinyl]-5-hydroxy-2,6-heptadienoic acid
2,6-Heptadienoic acid, 7-[4-(4-fluorophenyl)-6-(1-methylethyl)-2-[methyl(methylsulfonyl)amino]-5-pyrimidinyl]-5-hydroxy-, (2Z,5S,6E)-

Found 3 products.

Product data	Purity	Price range	Estimated delivery
Rosuvastatin EP Impurity K Sodium Salt REF: 4Z-R-09128CAS: 1422954-12-8	- - -	631.00 €~4,405.00 €	Thu 27 Mar 25
2Z-Dehydro Rosuvastatin sodium salt REF: TR-R700400CAS: 1422954-12-8	- - -	318.00 €~2,145.00 €	Mon 07 Apr 25
2,3-Anhydro rosuvastatin calcium REF: 3D-FA171115CAS: 1422954-12-8	Min. 95%	- - -	Discontinued product