CAS 1423-15-0
:1-Azido-2,3,4,5,6-pentafluorobenzene
Description:
1-Azido-2,3,4,5,6-pentafluorobenzene is a highly fluorinated aromatic compound characterized by the presence of five fluorine atoms and an azido functional group (-N3) attached to a benzene ring. The fluorine substituents significantly influence the compound's physical and chemical properties, including increased electronegativity and enhanced stability against oxidation. The azido group contributes to the compound's potential reactivity, particularly in click chemistry and as a precursor for various nitrogen-containing compounds. This substance is typically colorless to pale yellow and may exhibit low solubility in non-polar solvents due to its highly electronegative nature. Its unique structure makes it of interest in materials science and organic synthesis, particularly for applications in developing fluorinated polymers or as a building block in the synthesis of more complex molecules. However, due to the presence of the azido group, it may pose safety concerns, as azides can be sensitive to heat and shock, necessitating careful handling and storage.
Formula:C6F5N3
InChI:InChI=1S/C6F5N3/c7-1-2(8)4(10)6(13-14-12)5(11)3(1)9
InChI key:InChIKey=ZDEIQGWACCNREP-UHFFFAOYSA-N
SMILES:N(=[N+]=[N-])C1=C(F)C(F)=C(F)C(F)=C1F
Synonyms:- 2,3,4,5,6-Pentafluorophenyl azide
- Azide, pentafluorophenyl-
- Azidopentafluorobenzene
- Benzene, 1-azido-2,3,4,5,6-pentafluoro-
- Benzene, azidopentafluoro-
- Pentafluoroazidobenzene
- Pentafluorophenyl azide
- Perfluoroazidobenzene
- Perfluorophenyl azide
- 1-Azido-2,3,4,5,6-pentafluorobenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.