CAS 1423-27-4
:2-Trifluoromethylphenylboronic acid
Description:
2-Trifluoromethylphenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that has a trifluoromethyl substituent in the ortho position. This compound typically appears as a white to off-white solid and is known for its utility in organic synthesis, particularly in cross-coupling reactions such as Suzuki-Miyaura coupling, which is pivotal in the formation of carbon-carbon bonds. The trifluoromethyl group enhances the compound's lipophilicity and can influence its reactivity and selectivity in various chemical reactions. Additionally, the boronic acid moiety allows for the formation of stable complexes with diols, making it useful in the development of sensors and in medicinal chemistry for drug design. Its properties, such as solubility and stability, can vary depending on the solvent and conditions used. Safety precautions should be taken when handling this compound, as with many organoboron compounds, due to potential reactivity and toxicity.
Formula:C7H6BF3O2
InChI:InChI=1S/C7H6BF3O2/c9-7(10,11)5-3-1-2-4-6(5)8(12)13/h1-4,12-13H
InChI key:InChIKey=JNSBEPKGFVENFS-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(B(O)O)C=CC=C1
Synonyms:- 2-(Trifluoromethyl)phenylboronic acid
- 2-Trifluoromethylbenzeneboronic acid
- 2-[(Trifluoromethyl)-Benzene]-Boronic Acid
- B-[2-(Trifluoromethyl)phenyl]boronic acid
- Boronic acid, B-[2-(trifluoromethyl)phenyl]-
- Boronic acid, [2-(trifluoromethyl)phenyl]-
- o-Tolueneboronic acid, α,α,α-trifluoro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-(Trifluoromethyl)benzeneboronic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C7H6BF3O2Purity:97%Color and Shape:White to pale brown, Crystalline powderMolecular weight:189.93Boronic acid, B-[2-(trifluoromethyl)phenyl]-
CAS:Formula:C7H6BF3O2Purity:98%Color and Shape:SolidMolecular weight:189.92752-(Trifluoromethyl)phenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C7H6BF3O2Purity:97.0 to 111.0 %Color and Shape:White to Almost white powder to crystalMolecular weight:189.932-(Trifluoromethyl)benzeneboronic acid
CAS:2-(Trifluoromethyl)benzeneboronic acidFormula:C7H6BF3O2Purity:98%Color and Shape: white solidMolecular weight:189.92754g/mol2-(Trifluoromethyl)benzeneboronic acid
CAS:Formula:C7H6BF3O2Purity:95%Color and Shape:SolidMolecular weight:189.93





