CAS 1423-63-8

1-(5-BROMO-1-BENZOTHIEN-3-YL)ETHANONE

Description:

1-(5-Bromo-1-benzothien-3-yl)ethanone, with the CAS number 1423-63-8, is an organic compound characterized by its unique structure that includes a benzothienyl moiety and a ketone functional group. This compound features a bromine atom substituted at the 5-position of the benzothiophene ring, which contributes to its chemical reactivity and potential biological activity. The ethanone group indicates the presence of a carbonyl functional group (C=O) adjacent to an ethyl group, which can influence its reactivity in various chemical reactions, such as nucleophilic additions. The presence of the bromine atom can also enhance the compound's electrophilic character, making it a useful intermediate in organic synthesis. Additionally, compounds of this type may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. Overall, 1-(5-bromo-1-benzothien-3-yl)ethanone is a valuable compound in both synthetic and medicinal chemistry contexts.

Formula: C₁₀H₇BrOS

InChI: InChI=1/C10H7BrOS/c1-6(12)9-5-13-10-3-2-7(11)4-8(9)10/h2-5H,1H3

SMILES: CC(=O)c1csc2ccc(cc12)Br

Synonyms:

• 1-(5-Bromobenzo[B]Thiophen-3-Yl)Ethan-1-One
• 3-Acetyl-5-Bromo-Benzo[B]Thiophene
• 1-(5-Bromo-1-benzothien-3-yl)ethanone ,97%
• 1-(5-Bromo-1-Benzothiophen-3-Yl)Ethanone

Ethanone, 1-(5-bromobenzo[b]thien-3-yl)-

CAS: 1423-63-8

Formula: C₁₀H₇BrOS

Purity: 96%

Color and Shape: Solid

Molecular weight: 255.1310

Ref: IN-DA001I5C

3-Acetyl-5-bromobenzo[b]thiophene

CAS: 1423-63-8

3-Acetyl-5-bromobenzo[b]thiophene

Purity: 96%

Molecular weight: 255.13g/mol

Ref: 54-OR14496

1-(5-BROMOBENZO[B]THIOPHEN-3-YL)ETHANONE

CAS: 1423-63-8

Purity: 98%

Molecular weight: 255.1300049

Ref: 10-F823012