CAS 1423018-12-5

(βS)-4-[[5-[(3,4-Dihydro-8-methoxy-1(2H)-quinolinyl)methyl]-2-thienyl]methoxy]-β-1-propyn-1-ylbenzenepropanoic acid

Description:

The chemical substance known as (βS)-4-[[5-[(3,4-Dihydro-8-methoxy-1(2H)-quinolinyl)methyl]-2-thienyl]methoxy]-β-1-propyn-1-ylbenzenepropanoic acid, with the CAS number 1423018-12-5, is a complex organic compound characterized by its unique structural features. It contains multiple functional groups, including a propanoic acid moiety, a quinoline derivative, and a thienyl group, which contribute to its potential biological activity. The presence of the methoxy group suggests possible interactions with biological targets, while the propynyl and thienyl components may enhance its lipophilicity and membrane permeability. This compound is likely to exhibit specific stereochemistry, as indicated by the (βS) designation, which can influence its pharmacological properties. Such compounds are often investigated for their potential therapeutic applications, particularly in fields like medicinal chemistry and drug development. However, detailed studies would be necessary to elucidate its specific properties, mechanisms of action, and potential uses in various applications.

Formula: C₂₈H₂₉NO₄S

InChI: InChI=1S/C28H29NO4S/c1-3-6-22(17-27(30)31)20-10-12-23(13-11-20)33-19-25-15-14-24(34-25)18-29-16-5-8-21-7-4-9-26(32-2)28(21)29/h4,7,9-15,22H,5,8,16-19H2,1-2H3,(H,30,31)/t22-/m0/s1

InChI key: InChIKey=VJVDLRVFJTVWEO-QFIPXVFZSA-N

SMILES: C(N1C=2C(CCC1)=CC=CC2OC)C=3SC(COC4=CC=C([C@H](CC(O)=O)C#CC)C=C4)=CC3

Synonyms:

• (S)-3-(4-((5-((8-Methoxy-3,4-dihydroquinolin-1(2H)-yl)methyl)thiophen-2-yl)methoxy)phenyl)hex-4-ynoic acid
• (βS)-4-[[5-[(3,4-Dihydro-8-methoxy-1(2H)-quinolinyl)methyl]-2-thienyl]methoxy]-β-1-propyn-1-ylbenzenepropanoic acid
• Benzenepropanoic acid, 4-[[5-[(3,4-dihydro-8-methoxy-1(2H)-quinolinyl)methyl]-2-thienyl]methoxy]-β-1-propyn-1-yl-, (βS)-
• LY 2922470

LY2922470

CAS: 1423018-12-5

LY2922470

Purity: ≥90%

Molecular weight: 475.6g/mol

Ref: 54-BUP08648

LY 2922470

CAS: 1423018-12-5

LY 2922470 is an investigational compound, which is a small molecule inhibitor, derived from synthetic chemical sources, with specific activity against certain kinase enzymes. The mode of action of LY 2922470 involves binding to the ATP pocket of the targeted kinases, thereby inhibiting their phosphorylation activity, which is crucial in signaling pathways that regulate cell proliferation and survival.

Formula: C₂₈H₂₉NO₄S

Purity: Min. 95%

Molecular weight: 475.6 g/mol

Ref: 3D-YGC01812

LY2922470

CAS: 1423018-12-5

LY2922470: Selective GPR40 agonist; EC50=7nM (human), 1nM (mouse), 3nM (rat); lowers glucose, boosts insulin/GLP-1.

Formula: C₂₈H₂₉NO₄S

Purity: 95.11% - 97.08%

Color and Shape: Solid

Molecular weight: 475.6

Ref: TM-T15810